
CAS 2607-56-9
:(8S,9R)-8,9-Dihydro-8-[1-methyl-1-[[(2Z)-2-methyl-1-oxo-2-buten-1-yl]oxy]ethyl]-2-oxo-2H-furo[2,3-h]-1-benzopyran-9-yl (2Z)-2-methyl-2-butenoate
Description:
The chemical substance with the name "(8S,9R)-8,9-Dihydro-8-[1-methyl-1-[[(2Z)-2-methyl-1-oxo-2-buten-1-yl]oxy]ethyl]-2-oxo-2H-furo[2,3-h]-1-benzopyran-9-yl (2Z)-2-methyl-2-butenoate" and CAS number "2607-56-9" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as esters and ketones. This compound features a furocoumarin backbone, which is known for its biological activity, including potential phototoxicity and effects on cell signaling pathways. The stereochemistry indicated by the (8S,9R) configuration suggests specific spatial arrangements of atoms that can influence the compound's reactivity and interaction with biological systems. The presence of the (2Z)-2-methyl-2-butenoate moiety indicates that it may participate in various chemical reactions, including esterification and conjugation. Overall, this substance is of interest in fields such as medicinal chemistry and natural product synthesis, where its unique structure may contribute to its pharmacological properties.
Formula:C24H26O7
InChI:InChI=1S/C24H26O7/c1-7-13(3)22(26)30-20-18-16(11-9-15-10-12-17(25)29-19(15)18)28-21(20)24(5,6)31-23(27)14(4)8-2/h7-12,20-21H,1-6H3/b13-7-,14-8-/t20-,21+/m1/s1
InChI key:InChIKey=RVGGCRQPGKFZDS-AKRYRNCVSA-N
SMILES:O(C(/C(=C\C)/C)=O)[C@@H]1C=2C3=C(C=CC2O[C@@H]1[C@](OC(/C(=C\C)/C)=O)(C)C)C=CC(=O)O3
Synonyms:- Archangelicin
- 2-Butenoic acid, 2-methyl-, 8,9-dihydro-8-[1-methyl-1-[(2-methyl-1-oxo-2-butenyl)oxy]ethyl]-2-oxo-2H-furo[2,3-h]-1-benzopyran-9-yl ester, [8S-[8α(Z),9α(Z)]]-
- Crotonic acid, 2-methyl-, diester with 8,9-dihydro-9-hydroxy-8-(1-hydroxy-1-methylethyl)-2H-furo[2,3-h]-1-benzopyran-2-one, stereoisomer
- 2-Butenoic acid, 2-methyl-, (8S,9R)-8,9-dihydro-8-[1-methyl-1-[[(2Z)-2-methyl-1-oxo-2-butenyl]oxy]ethyl]-2-oxo-2H-furo[2,3-h]-1-benzopyran-9-yl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, (8S,9R)-8,9-dihydro-8-[1-methyl-1-[[(2Z)-2-methyl-1-oxo-2-buten-1-yl]oxy]ethyl]-2-oxo-2H-furo[2,3-h]-1-benzopyran-9-yl ester, (2Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Archangelicin
CAS:<p>Archangelicin is a useful organic compound for research related to life sciences. The catalog number is T125179 and the CAS number is 2607-56-9.</p>Formula:C24H26O7Color and Shape:SolidMolecular weight:426.465
