CAS 26071-07-8

N,2-dihydroxy-3-methylbenzamide

Description:

N,2-dihydroxy-3-methylbenzamide, with the CAS number 26071-07-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with hydroxyl groups and an amide functional group. The presence of two hydroxyl (-OH) groups at the 2 and 3 positions of the benzene ring contributes to its polarity and potential for hydrogen bonding, influencing its solubility in polar solvents. The methyl group at the 3 position provides additional steric hindrance and can affect the compound's reactivity and interaction with biological systems. This compound may exhibit various biological activities, making it of interest in pharmaceutical and biochemical research. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Overall, N,2-dihydroxy-3-methylbenzamide is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₈H₉NO₃

InChI: InChI=1/C8H9NO3/c1-5-3-2-4-6(7(5)10)8(11)9-12/h2-4,10,12H,1H3,(H,9,11)

SMILES: Cc1cccc(c1O)C(=NO)O

N,2-Dihydroxy-3-methylbenzamide

CAS: 26071-07-8

Versatile small molecule scaffold

Formula: C₈H₉NO₃

Purity: Min. 95%

Molecular weight: 167.16 g/mol

Ref: 3D-BBA07107