CAS 26088-25-5
:1,3,5,7-Tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane
Description:
1,3,5,7-Tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane, with CAS number 26088-25-5, is a complex organic compound characterized by its unique tricyclic structure that incorporates both phosphorus and oxygen atoms. This compound features a phosphatrane framework, which is notable for its stability and potential applications in various fields, including materials science and catalysis. The presence of multiple methyl groups contributes to its steric bulk and can influence its reactivity and solubility. The oxygen atoms in the structure suggest potential for hydrogen bonding and interactions with other polar substances. Additionally, the compound's unique arrangement may impart interesting electronic properties, making it a subject of interest in research related to coordination chemistry and organophosphorus chemistry. Its synthesis and characterization typically involve advanced organic synthesis techniques, and it may exhibit specific behaviors in terms of thermal stability and reactivity under different conditions. Overall, this compound represents a fascinating area of study within the realm of organophosphorus chemistry.
Formula:C10H17O3P
InChI:InChI=1S/C10H17O3P/c1-7-5-9(3)13-8(2,11-7)6-10(4,12-7)14-9/h14H,5-6H2,1-4H3
InChI key:InChIKey=DSYQHWPNJZFRCU-UHFFFAOYSA-N
SMILES:CC12CC3(C)OC(C)(O1)CC(C)(O2)P3
Synonyms:- 2,4,6-Trioxa-8-phosphaadamantane, 1,3,5,7-tetramethyl-
- 1,3,5,7-Tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane
- 1,3,5,7-Tetramethyl-2,4,8-trioxa-6-phospha-adamantane
- 2,4,6-Trioxa-8-phosphatricyclo[3.3.1.13,7]decane, 1,3,5,7-tetramethyl-
- CYTOP 216
- 2,4,6-Trioxa-1,3,5,7-tetramethyl-8-phaadamantane
- 2,4,6-Trioxa-1,3,5,7-tetraMethyl-8-phosphaadaMantane
- 1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphaadamantane
- 2,4,6-Trioxa-1,3,5,7-tetraMethyl-8-phosphaadaMantane (~32% in xylene)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,4,6-Trioxa-1,3,5,7-tetramethyl-8-phosphaadamantane (~30% in xylene)
CAS:2,4,6-Trioxa-1,3,5,7-tetramethyl-8-phosphaadamantane (~32% in xylene)
Formula:C10H17O3PColor and Shape:colorless to pale yellow liq.Molecular weight:216.212,4,6-Trioxa-1,3,5,7-tetramethyl-8-phosphaadamantane, 32% in xylene
CAS:Please enquire for more information about 2,4,6-Trioxa-1,3,5,7-tetramethyl-8-phosphaadamantane, 32% in xylene including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C10H17O3PColor and Shape:Clear LiquidMolecular weight:216.21 g/mol

