CymitQuimica logo

CAS 2609-10-1

:

4-(carbamoylamino)butanoate

Description:
4-(Carbamoylamino)butanoate, also known as 4-aminobutanoic acid carbamate, is an organic compound characterized by its structure, which includes a butanoate backbone with a carbamoylamino group. This compound features both an amine and a carboxylic acid functional group, making it an amino acid derivative. It is typically a white to off-white solid and is soluble in water due to the presence of polar functional groups. The presence of the carbamoyl group contributes to its potential as a biochemical intermediate or in pharmaceutical applications. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and solubility. As a derivative of butanoic acid, it may exhibit properties similar to other amino acids, such as participating in peptide synthesis or acting as a neurotransmitter precursor. Overall, 4-(carbamoylamino)butanoate is of interest in both organic chemistry and biochemistry for its potential applications in drug development and metabolic studies.
Formula:C5H9N2O3
InChI:InChI=1/C5H10N2O3/c6-5(10)7-3-1-2-4(8)9/h1-3H2,(H,8,9)(H3,6,7,10)/p-1
SMILES:C(CC(=O)O)CNC(=N)O
Synonyms:
  • Butanoic acid, 4-[(aminocarbonyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.