CAS 2609-10-1

4-(carbamoylamino)butanoate

Description:

4-(Carbamoylamino)butanoate, also known as 4-aminobutanoic acid carbamate, is an organic compound characterized by its structure, which includes a butanoate backbone with a carbamoylamino group. This compound features both an amine and a carboxylic acid functional group, making it an amino acid derivative. It is typically a white to off-white solid and is soluble in water due to the presence of polar functional groups. The presence of the carbamoyl group contributes to its potential as a biochemical intermediate or in pharmaceutical applications. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and solubility. As a derivative of butanoic acid, it may exhibit properties similar to other amino acids, such as participating in peptide synthesis or acting as a neurotransmitter precursor. Overall, 4-(carbamoylamino)butanoate is of interest in both organic chemistry and biochemistry for its potential applications in drug development and metabolic studies.

Formula: C₅H₉N₂O₃

InChI: InChI=1/C5H10N2O3/c6-5(10)7-3-1-2-4(8)9/h1-3H2,(H,8,9)(H3,6,7,10)/p-1

SMILES: C(CC(=O)O)CNC(=N)O

Synonyms:

• Butanoic acid, 4-[(aminocarbonyl)amino]-