CAS 26091-76-9
:(+)-Heraclenol
Description:
(+)-Heraclenol, with the CAS number 26091-76-9, is a naturally occurring organic compound classified as a sesquiterpene alcohol. It is characterized by its unique molecular structure, which includes multiple chiral centers, contributing to its optical activity. This compound is typically found in various plant species and is known for its potential biological activities, including antimicrobial and anti-inflammatory properties. (+)-Heraclenol is often studied for its role in the fragrance and flavor industry due to its pleasant aroma. Its solubility characteristics can vary, but it is generally soluble in organic solvents while having limited solubility in water. The compound's stability can be influenced by environmental factors such as temperature and light. As a chiral molecule, (+)-Heraclenol can exist in different enantiomeric forms, which may exhibit distinct biological activities. Overall, this compound is of interest in both natural product chemistry and potential therapeutic applications.
Formula:C16H16O6
InChI:InChI=1S/C16H16O6/c1-16(2,19)11(17)8-21-15-13-10(5-6-20-13)7-9-3-4-12(18)22-14(9)15/h3-7,11,17,19H,8H2,1-2H3/t11-/m1/s1
InChI key:InChIKey=FOINLJRVEBYARJ-LLVKDONJSA-N
SMILES:O(C[C@H](C(C)(C)O)O)C=1C2=C(C=C3C1OC=C3)C=CC(=O)O2
Synonyms:- (+)-Heraclenol
- 5-Benzofuranacrylic acid, 7-(2,3-dihydroxy-3-methylbutoxy)-6-hydroxy-, δ-lactone
- 7H-Furo(3,2-g)(1)benzopyran-7-one, 9-(2,3-dihydroxy-3-methylbutoxy)-, (R)-
- 7H-Furo[3,2-g][1]benzopyran-7-one, 9-(2,3-dihydroxy-3-methylbutoxy)-, stereoisomer
- 7H-Furo[3,2-g][1]benzopyran-7-one, 9-[(2R)-2,3-dihydroxy-3-methylbutoxy]-
- 9-[(2R)-2,3-Dihydroxy-3-methylbutoxy]-7H-furo[3,2-g][1]benzopyran-7-one
- Heraclenin oxide
- Komalin
- NSC 306227
- Prangenin hydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Isosaxalin; Heraclenol
CAS:<p>Isosaxalin; Heraclenol is a useful organic compound for research related to life sciences. The catalog number is T125178 and the CAS number is 26091-76-9.</p>Formula:C16H16O6Color and Shape:SolidMolecular weight:304.298
