CAS 26095-36-3

5-(morpholin-4-ylmethyl)furan-2-carboxylic acid

Description:

5-(Morpholin-4-ylmethyl)furan-2-carboxylic acid is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, participating in various chemical reactions, including esterification and amidation. The morpholine moiety, a six-membered ring containing both oxygen and nitrogen, contributes to the compound's potential for forming hydrogen bonds, enhancing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in pharmaceuticals, particularly in the design of compounds targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the substituents on the furan ring and the morpholine group, which may affect its interaction with biological targets or its behavior in synthetic reactions. Overall, 5-(morpholin-4-ylmethyl)furan-2-carboxylic acid represents a versatile scaffold for further chemical exploration.

Formula: C₁₀H₁₃NO₄

InChI: InChI=1/C10H13NO4/c12-10(13)9-2-1-8(15-9)7-11-3-5-14-6-4-11/h1-2H,3-7H2,(H,12,13)

SMILES: c1cc(C(=O)O)oc1CN1CCOCC1

Synonyms:

• 2-Furancarboxylic acid, 5-(4-morpholinylmethyl)-
• 5-(Morpholin-4-ylmethyl)-2-furoic acid

2-Furancarboxylic acid, 5-(4-morpholinylmethyl)-

CAS: 26095-36-3

Formula: C₁₀H₁₃NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 211.2145

Ref: IN-DA002RN7

5-(Morpholinomethyl)Furan-2-Carboxylic Acid

CAS: 26095-36-3

5-(Morpholinomethyl)Furan-2-Carboxylic Acid

Purity: 98%

Molecular weight: 211.22g/mol

Ref: 54-OR1011728

5-Morpholin-4-ylmethyl-furan-2-carboxylic acid

CAS: 26095-36-3

Formula: C₁₀H₁₃NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 211.217

Ref: 10-F020187