CAS 26095-97-6

furan-2,5-dicarbohydrazide

Description:

Furan-2,5-dicarbohydrazide is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features two hydrazide functional groups attached to the 2 and 5 positions of the furan ring, making it a dicarbohydrazide. It is typically a white to off-white solid and is soluble in polar solvents. Furan-2,5-dicarbohydrazide is known for its potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science, due to its ability to form coordination complexes and its reactivity with various electrophiles. The compound exhibits properties such as moderate thermal stability and can participate in condensation reactions, making it useful in the synthesis of polymers and other complex organic molecules. Additionally, its hydrazide groups can be involved in biological activities, which may contribute to its utility in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₆H₈N₄O₃

InChI: InChI=1/C6H8N4O3/c7-9-5(11)3-1-2-4(13-3)6(12)10-8/h1-2H,7-8H2,(H,9,11)(H,10,12)

SMILES: c1cc(C(=O)NN)oc1C(=O)NN

Synonyms:

• 2,5-Furandicarboxylic Acid, Dihydrazide

2,5-Furandicarboxylic acid, 2,5-dihydrazide

CAS: 26095-97-6

Formula: C₆H₈N₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 184.1527

Ref: IN-DA002RN2

Furan-2,5-Dicarbohydrazide

CAS: 26095-97-6

Furan-2,5-Dicarbohydrazide

Purity: 95%

Molecular weight: 184.15g/mol

Ref: 54-OR1028465

Furan-2,5-dicarbohydrazide

CAS: 26095-97-6

Purity: 98%

Molecular weight: 184.1549988

Ref: 10-F692889

Furan-2,5-dicarbohydrazide

Controlled Product

CAS: 26095-97-6

Applications furan-2,5-dicarbohydrazide (cas# 26095-97-6) is a useful research chemical.

Formula: C₆H₈N₄O₃

Color and Shape: Neat

Molecular weight: 184.15

Ref: TR-F840295