CymitQuimica logo

CAS 260973-78-2

:

3-(2,4-dichlorophenyl)isoxazole

Description:
3-(2,4-Dichlorophenyl)isoxazole is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of the 2,4-dichlorophenyl group indicates that the compound has two chlorine substituents on a phenyl ring, which can significantly influence its chemical properties and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or analgesic properties. The presence of halogen atoms, such as chlorine, often enhances the lipophilicity of the molecule, potentially affecting its interaction with biological targets. Additionally, the isoxazole moiety is known for its role in various biological activities, making this compound of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C9H5Cl2NO
InChI:InChI=1/C9H5Cl2NO/c10-6-1-2-7(8(11)5-6)9-3-4-12-13-9/h1-5H
InChI key:SPVRCFRPTDHTOO-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Cl)Cl)c1ccno1
Synonyms:
  • 5-(2,4-Dichlorophenyl)Isoxazole
Found 2 products.