CAS 26112-88-9
:2-O-(P-nitrophenyl)-A-D-N-*acetylneuraminic acid
Description:
2-O-(P-nitrophenyl)-A-D-N-acetylneuraminic acid, with the CAS number 26112-88-9, is a derivative of sialic acid, which is a family of nine-carbon sugars known for their role in cellular recognition and signaling. This compound features a p-nitrophenyl group at the 2-position of the neuraminic acid backbone, which enhances its solubility and reactivity, making it useful in biochemical applications. The acetyl group at the amino position contributes to its stability and influences its interaction with biological systems. Typically, this compound is characterized by its ability to participate in glycosylation reactions and can serve as a substrate for various enzymes, including sialidases. Its structural modifications allow for specific interactions with lectins and other carbohydrate-binding proteins, making it valuable in research related to cell adhesion, viral infections, and immunology. Additionally, the presence of the nitrophenyl group can facilitate spectroscopic analysis, aiding in the study of its properties and behavior in different environments.
Formula:C17H22N2O11
InChI:InChI=1/C17H22N2O11/c1-8(21)18-13-11(22)6-17(16(25)26,30-15(13)14(24)12(23)7-20)29-10-4-2-9(3-5-10)19(27)28/h2-5,11-15,20,22-24H,6-7H2,1H3,(H,18,21)(H,25,26)
SMILES:CC(=NC1C(CC(C(=O)O)(Oc2ccc(cc2)N(=O)=O)OC1C(C(CO)O)O)O)O
Synonyms:- 2-O-(4-Nitrophenyl)-N-acetylneuraminic acid
- 1-Npana
- 4-Nitrophenyl-5-acetamido-3,5-dideoxy-alpha-D-glycero-D-galacto-2-nonulopyranosidonic acid
- NP-Nan
- p-Nitrophenyl N-acetyl-alpha-D-neuraminide
- p-Nitrophenyl N-acetyl-alpha-neuraminide
- D-glycero-alpha-D-galacto-2-Nonulopyranosidonic acid, 4-nitrophenyl 5-(acetylamino)-3,5-dideoxy-
- (2S,4S,5R,6R)-5-(acetylamino)-4-hydroxy-2-(4-nitrophenoxy)-6-[(1R,2R)-1,2,3-trihydroxypropyl]tetrahydro-2H-pyran-2-carboxylate (non-preferred name)
- 4-nitrophenyl 5-(acetylamino)-3,5-dideoxy-D-glycero-alpha-D-galacto-non-2-ulopyranosidonato
- 4-Nitrophenyl 5-(Acetylamino)-3,5-Dideoxynon-2-Ulopyranosidonic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-Neuraminic acid, N-acetyl-2-O-(4-nitrophenyl)-
CAS:Formula:C17H22N2O11Purity:95%Molecular weight:430.36342-O-(4-Nitrophenyl)-a-D-N-acetylneuraminic acid
CAS:<p>2-O-(4-Nitrophenyl)-a-D-N-acetylneuraminic acid, also known as p-nitrophenyl N-acetylneuraminic acid, is a chromogenic substrate specifically designed for the detection and quantification of neuraminidase (sialidase) activity. Upon cleavage by neuraminidase, it releases a yellow-colored product, 4-nitrophenol, which can be easily monitored spectrophotometrically at 405 nm. This substrate is widely used in various applications, including enzyme kinetics studies, inhibitor screening, and the determination of neuraminidase activity in biological samples such as viruses, bacteria, and cell lysates. It is particularly useful for studying the enzymatic properties of neuraminidases from different sources and for the development of novel antiviral and antibacterial agents targeting neuraminidase activity.</p>Formula:C17H22N2O11Purity:Min. 90 Area-%Color and Shape:White PowderMolecular weight:430.36 g/mol


