CAS 26117-27-1
:N2-Acetyl-D-asparagine
Description:
N2-Acetyl-D-asparagine is a derivative of the amino acid asparagine, characterized by the addition of an acetyl group at the nitrogen atom of the side chain. This modification enhances its solubility and stability compared to its parent compound. The molecular formula typically reflects the presence of carbon, hydrogen, nitrogen, and oxygen atoms, indicative of its organic nature. As a polar molecule, N2-acetyl-D-asparagine can participate in various biochemical interactions, making it relevant in studies related to protein synthesis and metabolism. It is often utilized in research settings, particularly in the fields of biochemistry and pharmacology, to explore its role in cellular processes and potential therapeutic applications. The compound is generally stable under standard laboratory conditions but should be handled with care, as with all chemical substances, to avoid any adverse reactions. Its specific properties, such as melting point, solubility, and reactivity, can vary based on environmental conditions and the presence of other substances.
Formula:C6H10N2O4
InChI:InChI=1S/C6H10N2O4/c1-3(9)8-4(6(11)12)2-5(7)10/h4H,2H2,1H3,(H2,7,10)(H,8,9)(H,11,12)/t4-/m1/s1
InChI key:InChIKey=HXFOXFJUNFFYMO-SCSAIBSYSA-N
SMILES:[C@H](CC(N)=O)(NC(C)=O)C(O)=O
Synonyms:- (2R)-2-Acetamido-4-amino-4-oxobutanoic acid
- (2R)-3-Carbamoyl-2-acetamidopropanoic acid
- <span class="text-smallcaps">D</span>-Asparagine, N<sup>2</sup>-acetyl-
- Asparagine, N<sup>2</sup>-acetyl-, <span class="text-smallcaps">D</span>-
- N-Acetyl-<span class="text-smallcaps">D</span>-asparagine
- N-Acetyl-D-asparagine
- N-Acetyl-R-asparagine
- N2-Acetyl-D-asparagine
- N<sup>2</sup>-Acetyl-<span class="text-smallcaps">D</span>-asparagine
- Nalpha-Acetyl-D-Asparagine
- Asparagine, N2-acetyl-, D-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(R)-2-Acetamido-4-amino-4-oxobutanoic acid
CAS:(R)-2-Acetamido-4-amino-4-oxobutanoic acidPurity:95%Molecular weight:174.16g/molNalpha-Acetyl-D-asparagine
CAS:Nalpha-Acetyl-D-asparagine is a chiral amino acid that has been used to study the synthesis of peptides. It is soluble in water and can be used as a substrate for the enzymatic reaction of glyoxylate with ammonium sulfate. The Nalpha-acetyl group increases the affinity of this amino acid for sephadex g-100, a chromatographic material. This product can be prepared using a preparative column packed with silica gel and an eluent containing ammonium sulfate. It also has optical properties that make it useful for determining concentration and purity.
Formula:C6H10N2O4Purity:Min. 95%Molecular weight:174.15 g/mol



