CAS 26118-67-2
:N-(1-Methylethyl)sulfamoyl chloride
Description:
N-(1-Methylethyl)sulfamoyl chloride, with the CAS number 26118-67-2, is an organic compound characterized by the presence of a sulfamoyl group attached to an isopropyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the presence of the sulfonyl chloride functional group, which makes it a useful intermediate in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. The compound is soluble in organic solvents, such as dichloromethane and acetone, but is generally insoluble in water. It is important to handle this substance with care, as it can be corrosive and may cause irritation to the skin, eyes, and respiratory system. Proper safety precautions, including the use of personal protective equipment, are essential when working with this chemical. Its applications extend to pharmaceuticals and agrochemicals, where it serves as a building block for various chemical reactions.
Formula:C3H8ClNO2S
InChI:InChI=1S/C3H8ClNO2S/c1-3(2)5-8(4,6)7/h3,5H,1-2H3
InChI key:InChIKey=AGRDPCWQGGNEQL-UHFFFAOYSA-N
SMILES:N(S(Cl)(=O)=O)C(C)C
Synonyms:- Isopropylamidosulfonyl chloride
- Isopropylaminosulfonic acid
- Isopropylaminosulfonyl chloride
- Isopropylsulfamoyl chloride
- N-(1-Methylethyl)sulfamoyl chloride
- N-Isopropylchlorosulfonamide
- N-Isopropylsulfamoyl chloride
- Propan-2-Ylsulfamyl Chloride
- Sulfamoyl chloride, (1-methylethyl)-
- Sulfamoyl chloride, N-(1-methylethyl)-
- Sulfamoyl chloride, isopropyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Isopropylsulphamoyl chloride
CAS:Isopropylsulphamoyl chlorideFormula:C3H8ClNO2SPurity:95%Color and Shape: yellow oilMolecular weight:157.62g/molIsopropylsulfamoyl chloride
CAS:Purity:95.0%Color and Shape:Liquid, OilMolecular weight:157.61000061035156Isopropylsulfamoyl chloride
CAS:Isopropylsulfamoyl chloride is a chemical compound that is used for the production of methyl anthranilate, which is an intermediate in the synthesis of sulfanilamide. Isopropylsulfamoyl chloride has been shown to have anti-inflammatory properties and can be used to treat chronic arthritis. It also has an inhibitory effect on the production of amines, serine proteases, and other enzymes. Isopropylsulfamoyl chloride reacts with hydroxy groups in proteins and nucleic acids, leading to their cross-linking and denaturation. Isopropylsulfamoyl chloride reacts with carboxylic acid groups on the surface of herpes simplex virus (HSV) particles and inhibits the infectivity of HSV by inhibiting viral DNA synthesis. It also interacts with amino acid residues in proteins through its halide group, which can lead to protein aggregation or fragmentation. The sulphamic acid produced asFormula:C3H8ClNO2SPurity:Min. 95%Molecular weight:157.62 g/mol



