CAS 2612-02-4
:5-Methoxysalicylic acid
Description:
5-Methoxysalicylic acid, with the CAS number 2612-02-4, is an organic compound that belongs to the class of salicylic acids, which are characterized by the presence of both a hydroxyl group and a carboxylic acid group on a benzene ring. This particular compound features a methoxy group (-OCH3) at the 5-position of the salicylic acid structure, which influences its chemical properties and biological activity. It is typically a white to off-white crystalline solid that is soluble in organic solvents and exhibits limited solubility in water. 5-Methoxysalicylic acid is known for its potential anti-inflammatory and analgesic properties, making it of interest in pharmaceutical applications. Additionally, it may serve as an intermediate in the synthesis of various chemical compounds. Its stability and reactivity can be influenced by factors such as pH and temperature, and it may undergo typical reactions associated with carboxylic acids and phenolic compounds. As with many organic compounds, safety data should be consulted for handling and usage.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4,9H,1H3,(H,10,11)
InChI key:InChIKey=IZZIWIAOVZOBLF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(OC)=CC=C1O
Synonyms:- 2-Hydroxy-5-Methoxybenzoate
- 2-Hydroxy-5-methoxybenzoic acid
- 5-Methoxy-2-hydroxybenzenecarboxylic acid
- 5-Methoxy-2-hydroxybenzoic acid
- 6-Methoxy-m-anisic acid
- Benzoic acid, 2-hydroxy-5-methoxy-
- NSC 2579
- m-Anisic acid, 6-hydroxy-
- 5-Methoxysalicylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
5-Methoxysalicylic Acid
CAS:Formula:C8H8O4Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:168.15Benzoic acid, 2-hydroxy-5-methoxy-
CAS:Formula:C8H8O4Purity:98%Color and Shape:SolidMolecular weight:168.14675-Methoxysalicylic acid
CAS:Formula:C8H8O4Purity:≥ 99.0%Color and Shape:White to light-brown crystalline powderMolecular weight:168.155-Methoxysalicylic acid
CAS:5-Methoxysalicylic acidFormula:C8H8O4Purity:98%Color and Shape: off white crystalline solidMolecular weight:168.15g/mol5-Methoxysalicylic acid
CAS:5-Methoxysalicylic acid (5-MeOSA), a natural product, serves as an effective matrix for oligonucleotide analysis in MALDI MS when used alongside spermine.Formula:C8H8O4Purity:97.38%Color and Shape:SolidMolecular weight:168.156-Hydroxy-3-anisic acid
CAS:6-Hydroxy-3-anisic acid is a building block that can be used to synthesize complex compounds. It is a versatile intermediate that can be used in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. 6-Hydroxy-3-anisic acid has been shown to have high quality and purity, making it a valuable research chemical for scientific studies. It is also useful in the production of specialty chemicals such as dyes and perfumes.Formula:C8H8O4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:168.15 g/mol2-Hydroxy-5-methoxybenzoic acid
CAS:Formula:C8H8O4Purity:98%Color and Shape:SolidMolecular weight:168.1485-Methoxysalicylic acid
CAS:Controlled Product<p>Applications 5-Methoxysalicylic acid<br></p>Formula:C8H8O4Color and Shape:NeatMolecular weight:168.15







