CAS 26121-56-2

(2α)-2-Hydroxy-12-methoxypicras-12-ene-1,11,16-trione

Description:

(2α)-2-Hydroxy-12-methoxypicras-12-ene-1,11,16-trione, with the CAS number 26121-56-2, is a complex organic compound characterized by its unique structural features, including multiple functional groups. This substance belongs to the class of triterpenoids, which are known for their diverse biological activities. The presence of hydroxyl (-OH) and methoxy (-OCH3) groups contributes to its solubility and reactivity, making it a potential candidate for various applications in pharmaceuticals and natural product chemistry. The trione structure indicates the presence of three carbonyl (C=O) groups, which can significantly influence the compound's chemical behavior, including its reactivity and interaction with biological systems. Additionally, the stereochemistry denoted by (2α) suggests specific spatial arrangements of atoms, which can affect the compound's biological activity and interaction with enzymes or receptors. Overall, this compound's unique characteristics make it a subject of interest for further research in medicinal chemistry and natural product exploration.

Formula: C₂₁H₂₈O₆

InChI: InChI=1S/C21H28O6/c1-9-6-13(22)19(25)21(4)11(9)7-14-20(3)12(8-15(23)27-14)10(2)17(26-5)16(24)18(20)21/h9,11-14,18,22H,6-8H2,1-5H3/t9-,11+,12+,13+,14-,18+,20-,21+/m1/s1

InChI key: InChIKey=GESOKLRVLMVNMO-WCAPFRRUSA-N

SMILES: C[C@]12[C@]3([C@]4(C)[C@@](C[C@]1(OC(=O)C[C@]2(C(C)=C(OC)C3=O)[H])[H])([C@H](C)C[C@H](O)C4=O)[H])[H]

Synonyms:

• Picras-12-ene-1,11,16-trione, 2-hydroxy-12-methoxy-, (2α)-
• Phenanthro[10,1-bc]pyran-1,5,11(4H)-trione, 3aβ,6aβ,7,7aα,8,9,10,11a,11bα,11c-decahydro-10α-hydroxy-2-methoxy-3,8α,11aβ,11cβ-tetramethyl-
• Picrasin B
• Nigakilactone I
• (2α)-2-Hydroxy-12-methoxypicras-12-ene-1,11,16-trione

Picrasin B

CAS: 26121-56-2

Picrasin B shows a significant clastogenic activity in cell cultures of Don lung cells of Chinese hamster.

Formula: C₂₁H₂₈O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 376.44

Ref: TM-TN4787

Picrasin B

CAS: 26121-56-2

Formula: C₂₁H₂₈O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 376.449

Ref: BP-SBP01560

Picrasin B

Controlled Product

CAS: 26121-56-2

Picrasin B is a naturally occurring quassinoid, which is a secondary metabolite derived from the Picrasma genus, closely related to the Simaroubaceae family. These compounds are notable for their complex chemical structures and notable bioactivity. Picrasin B is extracted from plants like Picrasma quassioides and exhibits diverse bioactivities. It acts primarily by interfering with feeding behavior, making it an interesting candidate for antifeedant applications.

Formula: C₂₁H₂₈O₆

Purity: Min. 95%

Molecular weight: 376.4 g/mol

Ref: 3D-BBA12156