CymitQuimica logo

CAS 26126-76-1

:

(-)-3,9-Dihydro-2,2,3,9-tetramethylfuro[2,3-b]quinolin-4(2H)-one

Description:
(-)-3,9-Dihydro-2,2,3,9-tetramethylfuro[2,3-b]quinolin-4(2H)-one, with the CAS number 26126-76-1, is a complex organic compound characterized by its unique fused ring structure that combines elements of furan and quinoline. This compound typically exhibits a chiral center, contributing to its optical activity, which is significant in various chemical and biological applications. The presence of multiple methyl groups enhances its hydrophobic properties, influencing its solubility and reactivity. As a member of the quinoline family, it may exhibit biological activity, potentially serving as a scaffold for drug development. The compound's structure suggests it could participate in various chemical reactions, including electrophilic substitutions and cycloadditions, making it of interest in synthetic organic chemistry. Its specific properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods and could vary based on the conditions under which they are measured. Overall, this compound represents a fascinating area of study within medicinal chemistry and organic synthesis.
Formula:C15H17NO2
InChI:InChI=1/C15H17NO2/c1-9-12-13(17)10-7-5-6-8-11(10)16(4)14(12)18-15(9,2)3/h5-9H,1-4H3
InChI key:InChIKey=BXTFNWWMVUHWQA-UHFFFAOYNA-N
SMILES:O=C1C2=C(N(C)C=3C1=CC=CC3)OC(C)(C)C2C
Synonyms:
  • Lemobiline
  • (-)-3,9-Dihydro-2,2,3,9-tetramethylfuro[2,3-b]quinolin-4(2H)-one
  • Spectabiline
  • Spectabiline (Ravenia)
  • Furo[2,3-b]quinolin-4(2H)-one, 3,9-dihydro-2,2,3,9-tetramethyl-, (-)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.