CAS 2613-27-6
:(OC-6-21)-Pentafluoro(4-nitrophenyl)sulfur
Description:
(OC-6-21)-Pentafluoro(4-nitrophenyl)sulfur, with the CAS number 2613-27-6, is a specialized chemical compound that features a sulfur atom bonded to a pentafluorophenyl group and a nitro-substituted aromatic ring. This compound is characterized by its high electronegativity due to the presence of multiple fluorine atoms, which significantly influences its reactivity and stability. The nitro group (-NO2) attached to the phenyl ring enhances the compound's electron-withdrawing properties, making it useful in various chemical applications, including as a reagent in organic synthesis and in materials science. The presence of fluorine atoms contributes to its unique physical properties, such as increased thermal stability and potential hydrophobic characteristics. Additionally, the compound may exhibit interesting electronic properties, making it a subject of study in fields like medicinal chemistry and materials development. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.
Formula:C6H4F5NO2S
InChI:InChI=1S/C6H4F5NO2S/c7-15(8,9,10,11)6-3-1-5(2-4-6)12(13)14/h1-4H
InChI key:InChIKey=AGNCKMHGYZKMLN-UHFFFAOYSA-N
SMILES:S(F)(F)(F)(F)(F)C1=CC=C(N(=O)=O)C=C1
Synonyms:- (OC-6-21)-Pentafluoro(4-nitrophenyl)sulfur
- (p-Nitrophenyl)sulfur pentafluoride
- 1-Nitro-4-(Pentafluoro-Lambda~6~-Sulfanyl)Benzene
- 1-Nitro-4-(pentafluorosulfanyl)benzene
- 4-(Pentafluorosulfanyl)-1-nitrobenzene
- 4-Nitro(pentafluorosulfanyl)benzene
- 4-Nitrobenzenesulfur pentafluoride
- 4-Nitrobenzenesulphur pentafluoride
- 4-Nitrophenylsulfur pentafluoride
- Pentafluoro(4-nitrophenyl)sulfur
- Sulfur, pentafluoro(4-nitrophenyl)-, (OC-6-21)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Sulfur, pentafluoro(4-nitrophenyl)-, (OC-6-21)-
CAS:Formula:C6H4F5NO2SPurity:97%Color and Shape:SolidMolecular weight:249.15854-Nitrophenylsulphur pentafluoride
CAS:4-Nitrophenylsulphur pentafluoride
Formula:C6H4F5NO2SPurity:95%Color and Shape:SolidMolecular weight:249.16g/mol4-Nitrophenylsulfur Pentafluoride
CAS:Formula:C6H4F5NO2SPurity:>96.0%(GC)Color and Shape:White or Colorless to Yellow powder to lump to clear liquidMolecular weight:249.164-Nitrophenylsulfur pentafluoride
CAS:Formula:C6H4F5NO2SPurity:97%Color and Shape:SolidMolecular weight:249.16(Oc-6-21)-Pentafluoro(4-Nitrophenyl)-Sulfur
CAS:(Oc-6-21)-Pentafluoro(4-Nitrophenyl)-Sulfur is a halide that can be used in organic chemistry. It reacts with nucleophiles to form nucleophilic substitution products. The axial positions on the sulfur atom make it a good leaving group, which can lead to high yields of carbanions and quinoxalines. (Oc-6-21)-Pentafluoro(4-Nitrophenyl)-Sulfur has been used in the synthesis of many organic compounds, including cardiovascular drugs such as halides and benzene derivatives.
Formula:C6H4F5NO2SPurity:Min. 95%Molecular weight:249.16 g/mol




