CAS 2613-89-0
:Phenylmalonic acid
Description:
Phenylmalonic acid, with the CAS number 2613-89-0, is an organic compound characterized by its dicarboxylic acid structure, featuring two carboxyl (-COOH) groups and a phenyl group attached to a malonic acid backbone. It appears as a white crystalline solid and is soluble in water, reflecting its polar nature due to the presence of carboxylic acid groups. The compound exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Phenylmalonic acid is of interest in organic synthesis and can serve as a building block for the production of pharmaceuticals and other complex organic molecules. Additionally, it has been studied for its potential role in metabolic pathways and its implications in certain genetic disorders, such as phenylketonuria, where its accumulation can be detrimental. Overall, phenylmalonic acid is a versatile compound with significant relevance in both synthetic chemistry and biochemistry.
Formula:C9H8O4
InChI:InChI=1S/C9H8O4/c10-8(11)7(9(12)13)6-4-2-1-3-5-6/h1-5,7H,(H,10,11)(H,12,13)
InChI key:InChIKey=WWYDYZMNFQIYPT-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C(O)=O)C1=CC=CC=C1
Synonyms:- 1-Hydroxy-4-(P-Tolyamino)Anthraquinone
- 2-Phenylmalonic acid
- 2-Phenylpropanedioic acid
- Malonic acid, phenyl-
- NSC 27164
- NSC 41697
- Phenylpropanedioate
- Phenylpropanedioc acid
- Phenylpropanedioic Acid
- Propanedioic acid, 2-phenyl-
- Propanedioic acid, phenyl-
- Toluene-α,α-dicarboxylic acid
- α-Carboxyphenylacetic acid
- α-Phenylmalonic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Phenylmalonic Acid
CAS:Formula:C9H8O4Purity:>95.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:180.16Propanedioic acid, 2-phenyl-
CAS:Formula:C9H8O4Purity:98%Color and Shape:SolidMolecular weight:180.15742-phenylpropanedioic acid
CAS:2-phenylpropanedioic acidFormula:C9H8O4Purity:98%Color and Shape: pale yellow solidMolecular weight:180.16g/molPhenylmalonic acid
CAS:Phenylmalonic acid is a chemical compound that belongs to the group of organic acids. It can be synthesized by the oxidation of benzylmalonic acid with sodium dichromate and hydrochloric acid. Phenylmalonic acid has been shown to inhibit the growth of Escherichia coli in vitro. The antibacterial effect is due to its ability to block bacterial cells from absorbing monosodium phenyl phosphate, which is needed for cell wall synthesis. Phenylmalonic acid also exhibits a pharmacokinetic profile similar to malonic acid and x-ray crystallography shows that it has intramolecular hydrogen bonding, which may explain its high stability.Formula:C9H8O4Purity:Min. 97 Area-%Color and Shape:White Off-White PowderMolecular weight:180.16 g/molPhenylmalonic acid
CAS:Phenylmalonic acid is a useful organic compound for research related to life sciences. The catalog number is T65896 and the CAS number is 2613-89-0.Formula:C9H8O4Color and Shape:SolidMolecular weight:180.159






