CAS 2613-89-0: Phenylmalonic acid
Description:Phenylmalonic acid, with the CAS number 2613-89-0, is an organic compound characterized by its dicarboxylic acid structure, featuring two carboxyl (-COOH) groups and a phenyl group attached to a malonic acid backbone. It appears as a white crystalline solid and is soluble in water, reflecting its polar nature due to the presence of carboxylic acid groups. The compound exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Phenylmalonic acid is of interest in organic synthesis and can serve as a building block for the production of pharmaceuticals and other complex organic molecules. Additionally, it has been studied for its potential role in metabolic pathways and its implications in certain genetic disorders, such as phenylketonuria, where its accumulation can be detrimental. Overall, phenylmalonic acid is a versatile compound with significant relevance in both synthetic chemistry and biochemistry.
Formula:C9H8O4
InChI:InChI=1S/C9H8O4/c10-8(11)7(9(12)13)6-4-2-1-3-5-6/h1-5,7H,(H,10,11)(H,12,13)
InChI key:InChIKey=WWYDYZMNFQIYPT-UHFFFAOYSA-N
SMILES:O=C(O)C(C(=O)O)C=1C=CC=CC1
- Synonyms:
- 1-Hydroxy-4-(P-Tolyamino)Anthraquinone
- 2-Phenylmalonic acid
- 2-Phenylpropanedioic acid
- Malonic acid, phenyl-
- NSC 27164
- NSC 41697
- Phenylpropanedioate
- Phenylpropanedioc acid
- Phenylpropanedioic Acid
- Propanedioic acid, 2-phenyl-
- See more synonyms
- Propanedioic acid, phenyl-
- Toluene-α,α-dicarboxylic acid
- α-Carboxyphenylacetic acid
- α-Phenylmalonic acid
- Phenylmalonic acid
