CAS 261503-80-4

2,2-Difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetyl bromide

Description:

2,2-Difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetyl bromide is a fluorinated organic compound characterized by its complex structure, which includes multiple fluorine atoms and a bromide functional group. This compound is typically used in specialized applications, such as in the synthesis of pharmaceuticals or agrochemicals, due to its unique reactivity and properties imparted by the presence of fluorine. The fluorine atoms enhance the compound's stability, lipophilicity, and bioactivity, making it valuable in medicinal chemistry. Additionally, the presence of the bromide group suggests potential reactivity in nucleophilic substitution reactions. The compound is likely to be a colorless or pale yellow liquid or solid, depending on its purity and specific conditions. Safety precautions are essential when handling this substance, as it may pose health risks due to its chemical reactivity and the presence of halogens. Proper storage and disposal methods should be followed to mitigate environmental impact and ensure safety in laboratory settings.

Formula: C₅BrF₉O₃

InChI: InChI=1S/C5BrF9O3/c6-1(16)2(7,8)17-3(9,10)4(11,12)18-5(13,14)15

InChI key: InChIKey=UWPGPNWCEFPFJC-UHFFFAOYSA-N

SMILES: C(OC(C(Br)=O)(F)F)(C(OC(F)(F)F)(F)F)(F)F

Synonyms:

• 2,2-Difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetyl bromide
• Acetyl bromide, difluoro[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]-
• Acetyl bromide, 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]-

Nonafluoro-3,6-dioxaheptanoyl bromide

CAS: 261503-80-4

Nonafluoro-3,6-dioxaheptanoyl bromide

Purity: 97%

Molecular weight: 358.94132g/mol

Ref: 54-PC4705