CymitQuimica logo

CAS 2616-16-2

:

(16α,19E)-1-Acetyl-19,20-didehydrocuran-17-ol

Description:
(16α,19E)-1-Acetyl-19,20-didehydrocuran-17-ol, with the CAS number 2616-16-2, is a chemical compound that belongs to the class of terpenoids, specifically a type of sesquiterpene. This compound is characterized by its complex bicyclic structure, which includes multiple rings and functional groups such as an acetyl group and a hydroxyl group. The presence of the double bonds in the structure contributes to its reactivity and potential biological activity. It is typically found in various natural sources, particularly in certain plants, where it may play a role in defense mechanisms or as a signaling molecule. The compound's stereochemistry, indicated by the specific configuration at various carbon centers, is crucial for its biological interactions and properties. Due to its unique structure, it may exhibit various pharmacological effects, making it of interest in medicinal chemistry and natural product research. However, detailed studies are necessary to fully understand its potential applications and mechanisms of action.
Formula:C21H26N2O2
InChI:InChI=1S/C21H26N2O2/c1-3-14-11-22-9-8-21-17-6-4-5-7-18(17)23(13(2)25)20(21)16(12-24)15(14)10-19(21)22/h3-7,15-16,19-20,24H,8-12H2,1-2H3/b14-3-/t15-,16-,19-,20-,21+/m0/s1
InChI key:InChIKey=IJTKEUDLEABZCZ-SEACFGBCSA-N
SMILES:C(C)(=O)N1[C@@]2([C@@]3([C@]4(N(CC3)C\C(=C\C)\[C@@]([C@@H]2CO)(C4)[H])[H])C=5C1=CC=CC5)[H]
Synonyms:
  • Curan-17-ol, 1-acetyl-19,20-didehydro-, (16α,19E)-
  • (16α,19E)-1-Acetyl-19,20-didehydrocuran-17-ol
  • NSC 325309
  • Retuline
  • 3,5-Ethano-3H-pyrrolo[2,3-d]carbazole, curan-17-ol deriv.
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.