CAS 261621-12-9
:3-(tert-Butyldimethylsiloxy)benzeneboronic acid
Description:
3-(tert-Butyldimethylsiloxy)benzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a benzene ring, which is further substituted with a tert-butyldimethylsiloxy group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The tert-butyldimethylsiloxy group enhances the compound's stability and solubility in organic solvents, while also providing steric hindrance that can influence reactivity. The presence of the boronic acid moiety allows for participation in cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, this compound may exhibit moderate to high polarity due to the boronic acid group, affecting its interactions in different chemical environments. Overall, 3-(tert-Butyldimethylsiloxy)benzeneboronic acid is a versatile compound with significant utility in synthetic organic chemistry.
Formula:C12H21BO3Si
InChI:InChI=1/C12H21BO3Si/c1-12(2,3)17(4,5)16-11-8-6-7-10(9-11)13(14)15/h6-9,14-15H,1-5H3
SMILES:CC(C)(C)[Si](C)(C)Oc1cccc(c1)B(O)O
Synonyms:- (3-{[tert-Butyl(dimethyl)silyl]oxy}phenyl)boronic acid
- boronic acid, B-[3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]phenyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(tert-Butyldimethylsilyloxy)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C12H21BO3SiPurity:97.0 to 108.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:252.193-(tert-Butyldimethylsiloxy)benzeneboronic acid, tech. 90%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C12H21BO3SiPurity:90%Color and Shape:White to pale cream, PowderMolecular weight:252.193-(T-Butyldimethylsilyloxy)phenylboronic acid
CAS:Formula:C12H21BO3SiPurity:98%Color and Shape:SolidMolecular weight:252.18983-(tert-Butyldimethylsilyloxy)phenylboronic acid
CAS:<p>3-(tert-Butyldimethylsilyloxy)phenylboronic acid</p>Purity:98%Molecular weight:252.19g/mol




