CAS 261623-65-8

4-(3-Chlorophenyl)-1-piperazineacetamidoxime

Description:

4-(3-Chlorophenyl)-1-piperazineacetamidoxime, with the CAS number 261623-65-8, is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a chlorophenyl group, indicating the presence of a chlorine atom on a phenyl ring, which can influence its biological activity and solubility. The amidoxime functional group contributes to its reactivity, particularly in forming coordination complexes with metal ions or participating in various organic reactions. The presence of both the piperazine and amidoxime functionalities suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. Additionally, the chlorophenyl moiety may enhance lipophilicity, affecting the compound's pharmacokinetics. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₂H₁₇ClN₄O

InChI: InChI=1/C12H17ClN4O/c13-10-2-1-3-11(8-10)17-6-4-16(5-7-17)9-12(14)15-18/h1-3,8,18H,4-7,9H2,(H2,14,15)

SMILES: c1cc(cc(c1)N1CCN(CC1)CC(=N)NO)Cl

Synonyms:

• 1-piperazineethanimidamide, 4-(3-chlorophenyl)-N'-hydroxy-
• 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-hydroxyethanimidamide
• 2-[4-(3-chlorophenyl)piperazin-1-yl]-N'-hydroxy-acetamidine

2-[4-(3-chlorophenyl)piperazin-1-yl]-N'-hydroxyethanimidamide

CAS: 261623-65-8

Formula: C₁₂H₁₇ClN₄O

Molecular weight: 268.7426

Ref: IN-DA002RWU

2-[4-(3-Chlorophenyl)piperazin-1-yl]-N-hydroxyethanimidamide

CAS: 261623-65-8

Versatile small molecule scaffold

Formula: C₁₂H₁₇ClN₄O

Purity: Min. 95%

Molecular weight: 268.75 g/mol

Ref: 3D-LKA62365