CAS 261625-67-6: 6-fluoro-5-methylpyridine-3-carbonitrile

Description:6-Fluoro-5-methylpyridine-3-carbonitrile is a heterocyclic organic compound characterized by a pyridine ring substituted with a fluorine atom, a methyl group, and a cyano group. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The methyl group contributes to the overall hydrophobic character, while the cyano group introduces a polar functional group that can participate in various chemical reactions, such as nucleophilic additions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structure allows for potential interactions with biological targets, and the specific arrangement of substituents can affect its binding affinity and selectivity. Additionally, the compound's stability and solubility in various solvents can be influenced by the presence of these functional groups. Overall, 6-fluoro-5-methylpyridine-3-carbonitrile is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula:C₇H₅FN₂

InChI:InChI=1/C7H5FN2/c1-5-2-6(3-9)4-10-7(5)8/h2,4H,1H3

Synonyms:
3-Pyridinecarbonitrile, 6-fluoro-5-methyl-
6-Fluoro-5-methylnicotinonitrile
5-Cyano-2-Fluoro-3-Picoline

Found 5 products.

Product data	Purity	Price range	Estimated delivery
6-Fluoro-5-methylnicotinonitrile REF: 10-F321209CAS: 261625-67-6	95.0%	36.00 €~462.00 €	Tue 29 Apr 25
3-Pyridinecarbonitrile, 6-fluoro-5-methyl- REF: IN-DA002RWTCAS: 261625-67-6	95%	43.00 €~659.00 €	Tue 06 May 25
5-Cyano-2-fluoro-3-picoline (5-Cyano-2-fluoro-3-methylpyridine) REF: 7W-GK0707CAS: 261625-67-6	- - -	To inquire	Mon 05 May 25
6-Fluoro-5-methylnicotinonitrile REF: 54-PC2991CAS: 261625-67-6	95%	95.00 €~838.00 €	Tue 13 May 25
6-Fluoro-5-methyl-3-pyridinecarbonitrile REF: 3D-FF99702CAS: 261625-67-6	Min. 95%	- - -	Discontinued product