CAS 261635-93-2

2-Methyl-6-(trifluoromethyl)nicotinic acid

Description:

2-Methyl-6-(trifluoromethyl)nicotinic acid is a chemical compound that belongs to the class of nicotinic acids, which are derivatives of pyridine. This substance features a pyridine ring substituted with a methyl group at the 2-position and a trifluoromethyl group at the 6-position, contributing to its unique properties. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Additionally, the trifluoromethyl group can impart unique electronic properties, making it a valuable building block in the synthesis of more complex molecules.

Formula: C₈H₆F₃NO₂

InChI: InChI=1/C8H6F3NO2/c1-4-5(7(13)14)2-3-6(12-4)8(9,10)11/h2-3H,1H3,(H,13,14)

SMILES: Cc1c(ccc(C(F)(F)F)n1)C(=O)O

Synonyms:

• 3-Pyridinecarboxylic acid, 2-methyl-6-(trifluoromethyl)-
• 2-Methyl-6-(Trifluoromethyl)Pyridine-3-Carboxylic Acid

2-Methyl-6-(trifluoromethyl)nicotinic acid, 97%

CAS: 261635-93-2

2-Methyl-6-(trifluoromethyl)nicotinic acid is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item

Formula: C₈H₆F₃NO₂

Purity: 97%

Color and Shape: Crystals or powder or crystalline powder, White to cream

Molecular weight: 205.14

Ref: 02-H33003

3-Pyridinecarboxylic acid, 2-methyl-6-(trifluoromethyl)-

CAS: 261635-93-2

Formula: C₈H₆F₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.1339

Ref: IN-DA002RXH

2-Methyl-6-(trifluoromethyl)nicotinic acid

CAS: 261635-93-2

2-Methyl-6-(trifluoromethyl)nicotinic acid

Formula: C₈H₆F₃NO₂

Purity: ≥95%

Color and Shape: yellow to pale brown powder

Molecular weight: 205.13g/mol

Ref: 54-PC8524

2-Methyl-6-(trifluoromethyl)pyridine-3-carboxylic acid

CAS: 261635-93-2

Formula: C₈H₆F₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 205.136

Ref: 10-F005903