CAS 261635-93-2
:2-Methyl-6-(trifluoromethyl)nicotinic acid
Description:
2-Methyl-6-(trifluoromethyl)nicotinic acid is a chemical compound that belongs to the class of nicotinic acids, which are derivatives of pyridine. This substance features a pyridine ring substituted with a methyl group at the 2-position and a trifluoromethyl group at the 6-position, contributing to its unique properties. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Additionally, the trifluoromethyl group can impart unique electronic properties, making it a valuable building block in the synthesis of more complex molecules.
Formula:C8H6F3NO2
InChI:InChI=1/C8H6F3NO2/c1-4-5(7(13)14)2-3-6(12-4)8(9,10)11/h2-3H,1H3,(H,13,14)
SMILES:Cc1c(ccc(C(F)(F)F)n1)C(=O)O
Synonyms:- 3-Pyridinecarboxylic acid, 2-methyl-6-(trifluoromethyl)-
- 2-Methyl-6-(Trifluoromethyl)Pyridine-3-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Methyl-6-(trifluoromethyl)nicotinic acid, 97%
CAS:2-Methyl-6-(trifluoromethyl)nicotinic acid is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item
Formula:C8H6F3NO2Purity:97%Color and Shape:Crystals or powder or crystalline powder, White to creamMolecular weight:205.143-Pyridinecarboxylic acid, 2-methyl-6-(trifluoromethyl)-
CAS:Formula:C8H6F3NO2Purity:98%Color and Shape:SolidMolecular weight:205.1339Ref: IN-DA002RXH
1g62.00€5g128.00€10g180.00€25g529.00€100gTo inquire250gTo inquire100mg34.00€250mg46.00€2-Methyl-6-(trifluoromethyl)nicotinic acid
CAS:2-Methyl-6-(trifluoromethyl)nicotinic acidFormula:C8H6F3NO2Purity:≥95%Color and Shape: yellow to pale brown powderMolecular weight:205.13g/mol2-Methyl-6-(trifluoromethyl)pyridine-3-carboxylic acid
CAS:Formula:C8H6F3NO2Purity:95%Color and Shape:SolidMolecular weight:205.136



