CAS 26170-87-6

4-Phenyl-2-thiophenecarboxaldehyde

Description:

4-Phenyl-2-thiophenecarboxaldehyde is an organic compound characterized by its aromatic structure, which includes a phenyl group and a thiophene ring. This compound features a carboxaldehyde functional group (-CHO) attached to the thiophene, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a yellowish to brownish liquid or solid, depending on the specific conditions and purity. The presence of both the thiophene and phenyl groups imparts unique electronic properties, making it of interest in materials science and organic electronics. Additionally, the compound may exhibit biological activity, which can be explored for potential pharmaceutical applications. Its synthesis often involves methods such as electrophilic aromatic substitution or other coupling reactions. As with many organic compounds, handling precautions should be observed due to potential toxicity or reactivity. Overall, 4-Phenyl-2-thiophenecarboxaldehyde serves as a valuable building block in the development of various chemical products and research applications.

Formula: C₁₁H₈OS

InChI: InChI=1S/C11H8OS/c12-7-11-6-10(8-13-11)9-4-2-1-3-5-9/h1-8H

InChI key: InChIKey=TXIFKGWOQSVIMZ-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(=CS1)C2=CC=CC=C2

Synonyms:

• 2-Thiophenecarboxaldehyde, 4-phenyl-
• 4-Phenyl-2-thiophenecarboxaldehyde
• 4-Phenylthiophene-2-Carbaldehyde
• 4-Phenylthiophene-2-aldehyde

2-Thiophenecarboxaldehyde, 4-phenyl-

CAS: 26170-87-6

Formula: C₁₁H₈OS

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.2456

Ref: IN-DA002RZ5

4-Phenylthiophene-2-Carbaldehyde

CAS: 26170-87-6

4-Phenylthiophene-2-Carbaldehyde

Purity: 98%

Molecular weight: 188.25g/mol

Ref: 54-OR1011664

4-Phenylthiophene-2-carbaldehyde

CAS: 26170-87-6

Formula: C₁₁H₈OS

Purity: 97%

Molecular weight: 188.24

Ref: 10-F544880

4-Phenylthiophene-2-carboxaldehyde

CAS: 26170-87-6

4-Phenylthiophene-2-carboxaldehyde is an antimicrobial agent that exhibits a broad spectrum of activity against bacteria, fungi, and viruses. It has been shown to be effective at low concentrations of 0.5 ppm against both Gram-positive and Gram-negative bacteria. It is also a relatively stable compound that can be used in optical devices with yields of up to 95%. Ciprofloxacin is a ligand for this compound, forming a complex that is more stable than the free drug. This complex has been shown to have antibacterial activity against Staphylococcus aureus and methicillin resistant Staphylococcus aureus (MRSA). The catalytic reaction time for this compound is approximately 10 minutes. Lanthanides are also known to catalyze the reaction between 4-phenylthiophene-2-carboxaldehyde and amines, making it possible to produce 2-[(4-phenylthiop

Formula: C₁₁H₈OS

Purity: Min. 95%

Molecular weight: 188.25 g/mol

Ref: 3D-BBA17087