CAS 261704-48-7
:5-(4-pentylphenyl)-4H-1,2,4-triazole-3-thiol
Description:
5-(4-Pentylphenyl)-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a thiol (-SH) functional group, which contributes to its reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the pentylphenyl substituent enhances its hydrophobic properties, potentially influencing its solubility and interaction with biological systems. The compound may exhibit antioxidant properties due to the thiol group, making it of interest in medicinal chemistry. Additionally, its unique structure may allow for specific interactions with metal ions, which could be relevant in coordination chemistry. Overall, 5-(4-pentylphenyl)-4H-1,2,4-triazole-3-thiol is a versatile compound with potential applications in drug development and as a building block in organic synthesis. Its characteristics, including molecular stability and reactivity, make it a subject of interest for further research and exploration in various scientific domains.
Formula:C13H17N3S
InChI:InChI=1/C13H17N3S/c1-2-3-4-5-10-6-8-11(9-7-10)12-14-13(17)16-15-12/h6-9H,2-5H2,1H3,(H2,14,15,16,17)
SMILES:CCCCCc1ccc(cc1)c1nc([nH]n1)S
Synonyms:- 5-(4-pentylphenyl)-1,2-dihydro-3H-1,2,4-triazole-3-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
