CAS 26171-04-0
:1-Ethyl-2-(nitromethylene)pyrrolidine
Description:
1-Ethyl-2-(nitromethylene)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with an ethyl group and a nitromethylene group. This compound typically exhibits properties associated with both nitrogen-containing heterocycles and nitro compounds. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the nitro group suggests that it may have explosive or energetic properties, making it of interest in fields such as materials science and explosives research. Additionally, the pyrrolidine ring contributes to its potential biological activity, as many pyrrolidine derivatives are known for their pharmacological effects. The compound's reactivity may be influenced by the electron-withdrawing nature of the nitro group, which can affect its stability and interactions with other chemical species. Safety precautions should be taken when handling this compound due to its potential hazards associated with nitro compounds.
Formula:C7H12N2O2
InChI:InChI=1S/C7H12N2O2/c1-2-8-5-3-4-7(8)6-9(10)11/h6H,2-5H2,1H3
InChI key:InChIKey=MSXAUUYIGJZVTR-UHFFFAOYSA-N
SMILES:C(N(=O)=O)=C1N(CC)CCC1
Synonyms:- Pyrrolidine, 1-ethyl-2-(nitromethylene)-
- 1-Ethyl-2-(nitromethylene)pyrrolidine
- 1-Ethyl-2-(nitromethylidene)pyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
