CymitQuimica logo

CAS 261762-50-9

:

1-(5-Methyl-2-pyridyl)piperazine

Description:
1-(5-Methyl-2-pyridyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 5-methyl-2-pyridyl group attached to one of the nitrogen atoms of the piperazine, contributing to its unique properties. It is typically a white to off-white solid and is soluble in various organic solvents, which makes it useful in pharmaceutical applications. The presence of the pyridine ring imparts basicity to the molecule, allowing it to interact with biological targets, particularly in the central nervous system. This compound may exhibit various pharmacological activities, including potential anxiolytic or antidepressant effects, due to its structural similarity to other psychoactive substances. Additionally, its molecular structure allows for the possibility of forming salts, which can enhance its solubility and bioavailability. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.
Formula:C6H3ClF2O
InChI:InChI=1/C6H3ClF2O/c7-5-3(8)1-2-4(9)6(5)10/h1-2,10H
InChI key:IXIZSAAJTPZUBU-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1F)Cl)O)F
Synonyms:
  • Phenol, 2-chloro-3,6-difluoro-
  • Qr Bg Cf Ff
  • 2-Chloro-3,6-Difluorophenol
Found 4 products.