CAS 261763-02-4

3-Chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde

Description:

3-Chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde is an aromatic aldehyde characterized by the presence of a benzene ring substituted with a chlorine atom, a fluorine atom, and a trifluoromethyl group, along with an aldehyde functional group. This compound features a complex structure that contributes to its unique chemical properties, including its reactivity and potential applications in organic synthesis and pharmaceuticals. The presence of multiple electronegative substituents, such as chlorine and fluorine, enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic additions. Additionally, the trifluoromethyl group is known for imparting lipophilicity and influencing the biological activity of compounds. The compound is typically handled with care due to its potential toxicity and environmental impact. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the overall structure, which are important for its practical applications in research and industry.

Formula: C₈H₃ClF₄O

InChI: InChI=1S/C8H3ClF4O/c9-6-2-5(8(11,12)13)1-4(3-14)7(6)10/h1-3H

InChI key: InChIKey=MSZTVIFIFJCNRQ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(C=O)=C(F)C(Cl)=C1

Synonyms:

• Benzaldehyde, 3-chloro-2-fluoro-5-(trifluoromethyl)-
• 2-Fluoro-3-chloro-5-trifluoromethylbenzaldehyde
• 3-Chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde
• 3-Chloro-5-trifluoromethyl-2-fluorobenzaldehyde

Benzaldehyde, 3-chloro-2-fluoro-5-(trifluoromethyl)-

CAS: 261763-02-4

Formula: C₈H₃ClF₄O

Purity: 96%

Color and Shape: Solid

Molecular weight: 226.5554

Ref: IN-DA002S1R

3-Chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde

CAS: 261763-02-4

3-Chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde

Formula: C₈H₃ClF₄O

Purity: 96%

Color and Shape: colourless liquid

Molecular weight: 226.55543g/mol

Ref: 54-PC0144

3-Chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde

CAS: 261763-02-4

Formula: C₈H₃ClF₄O

Purity: 96%

Color and Shape: Liquid

Molecular weight: 226.55

Ref: 10-F005675

3-Chloro-2-Fluoro-5-(Trifluoromethyl)Benzaldehyde

CAS: 261763-02-4

3-Chloro-2-Fluoro-5-(Trifluoromethyl)Benzaldehyde is a Grignard reagent that reacts with alkyl halides to produce substituted aromatic compounds. It is an organic solvent and can be used in the reaction of metalorganic compounds. 3-Chloro-2-Fluoro-5-(Trifluoromethyl)Benzaldehyde is a strong electrophile, which undergoes deprotonation to form the corresponding enolate ion. This compound is often used as a halide in organic synthesis and as a catalyst for Friedel Crafts reactions.

Formula: C₈H₃ClF₄O

Purity: Min. 95%

Molecular weight: 226.56 g/mol

Ref: 3D-FC91607