CAS 26177-51-5

(4-methylbenzyl)hydrazinium chloride

Description:

(4-Methylbenzyl)hydrazinium chloride is an organic compound characterized by its hydrazinium functional group, which is derived from hydrazine. It features a 4-methylbenzyl moiety, indicating the presence of a methyl group attached to a benzyl group at the para position. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. Its chemical structure allows it to participate in various chemical reactions, including those typical of hydrazines, such as condensation and oxidation reactions. (4-Methylbenzyl)hydrazinium chloride may be utilized in organic synthesis, particularly in the preparation of other hydrazine derivatives or as a reagent in chemical reactions. Safety precautions should be observed when handling this compound, as hydrazines can be toxic and potentially hazardous. Proper storage conditions and handling protocols are essential to ensure safety in laboratory settings.

Formula: C₈H₁₃ClN₂

InChI: InChI=1/C8H12N2.ClH/c1-7-2-4-8(5-3-7)6-10-9;/h2-5,10H,6,9H2,1H3;1H

SMILES: Cc1ccc(cc1)CNN.Cl

Hydrazine, [(4-methylphenyl)methyl]-, hydrochloride (1:1)

CAS: 26177-51-5

Formula: C₈H₁₃ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 172.6552

Ref: IN-DA002S3F

(4-Methylbenzyl)hydrazine hydrochloride

CAS: 26177-51-5

(4-Methylbenzyl)hydrazine hydrochloride

Purity: 95%

Molecular weight: 172.65522g/mol

Ref: 54-OR75407

(4-Methylbenzyl)hydrazine hydrochloride

CAS: 26177-51-5

Formula: C₈H₁₃ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 172.66

Ref: 10-F061217