
CAS 2618-25-9
:Ioglycamic acid
Description:
Ioglycamic acid, with the CAS number 2618-25-9, is a chemical compound that belongs to the class of amino acids. It is characterized by the presence of both carboxylic acid and amine functional groups, which contribute to its properties as an amino acid derivative. This compound is typically a white crystalline solid, soluble in water, and exhibits a relatively stable structure under standard conditions. Ioglycamic acid is known for its potential applications in various fields, including pharmaceuticals and biochemistry, where it may serve as a building block for peptide synthesis or as a reagent in organic synthesis. Its unique structure allows it to participate in various chemical reactions, making it a valuable compound in research and industrial applications. Additionally, like many amino acids, it may play a role in biological processes, although specific biological functions and mechanisms may require further investigation. Overall, Ioglycamic acid is a compound of interest due to its chemical properties and potential utility in scientific research.
Formula:C18H10I6N2O7
InChI:InChI=1S/C18H10I6N2O7/c19-5-1-7(21)15(13(23)11(5)17(29)30)25-9(27)3-33-4-10(28)26-16-8(22)2-6(20)12(14(16)24)18(31)32/h1-2H,3-4H2,(H,25,27)(H,26,28)(H,29,30)(H,31,32)
InChI key:InChIKey=FZDZULUFHNDEDJ-UHFFFAOYSA-N
SMILES:N(C(COCC(NC1=C(I)C(C(O)=O)=C(I)C=C1I)=O)=O)C2=C(I)C(C(O)=O)=C(I)C=C2I
Synonyms:- Benzoic acid, 3,3′-[oxybis[(1-oxo-2,1-ethanediyl)imino]]bis[2,4,6-triiodo-
- 3,3′-[Oxybis[(1-oxo-2,1-ethanediyl)imino]]bis[2,4,6-triiodobenzoic acid]
- Benzoic acid, 3,3′-(diglycoloyldiimino)bis[2,4,6-triiodo-
- Benzoic acid, 3,3′-[oxybis(methylenecarbonylimino)]bis[2,4,6-triiodo-
- BE 419
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ioglycamic acid
CAS:Iodoxylic acid, a mixture of meglumine and sodium salts, is used to visualize the biliary tract as a radiopaque diagnostic aid.Formula:C18H10I6N2O7Color and Shape:SolidMolecular weight:1127.71
