CymitQuimica logo

CAS 26180-29-0

:

3-(2-Methyl-5-phenyl-1H-pyrrol-1-yl)benzoic acid

Description:
3-(2-Methyl-5-phenyl-1H-pyrrol-1-yl)benzoic acid, with the CAS number 26180-29-0, is an organic compound characterized by its complex structure that includes a benzoic acid moiety and a pyrrole derivative. This compound features a pyrrole ring substituted with a methyl group and a phenyl group, contributing to its unique chemical properties. The presence of the carboxylic acid functional group (-COOH) in the benzoic acid portion imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. The compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic components. Additionally, the presence of multiple functional groups suggests potential for biological activity, making it of interest in medicinal chemistry and drug development. Its structural complexity may also influence its reactivity and interactions with other molecules, which can be explored in various chemical and pharmaceutical applications.
Formula:C18H15NO2
InChI:InChI=1S/C18H15NO2/c1-13-10-11-17(14-6-3-2-4-7-14)19(13)16-9-5-8-15(12-16)18(20)21/h2-12H,1H3,(H,20,21)
InChI key:InChIKey=IDROEJGETCAVOO-UHFFFAOYSA-N
SMILES:CC=1N(C(=CC1)C2=CC=CC=C2)C3=CC(C(O)=O)=CC=C3
Synonyms:
  • 3-(2-Methyl-5-phenyl-1H-pyrrol-1-yl)benzoic acid
  • Benzoic acid, 3-(2-methyl-5-phenyl-1H-pyrrol-1-yl)-
  • Benzoic acid, m-(2-methyl-5-phenylpyrrol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.