CAS 26184-88-3
:[2S-[2α,5β(R*)]]-tetrahydro-α,α,5-trimethyl-5-(4-methyl-3-cyclohexen-1-yl)furan-2-methanol
Description:
The chemical substance with the name "[2S-[2α,5β(R*)]]-tetrahydro-α,α,5-trimethyl-5-(4-methyl-3-cyclohexen-1-yl)furan-2-methanol" and CAS number 26184-88-3 is a complex organic compound characterized by its unique structural features, including a tetrahydrofuran ring and multiple methyl groups. This compound exhibits chirality, indicated by the specific stereochemistry at the 2S and 5β positions, which can influence its biological activity and interactions. The presence of a cyclohexene moiety contributes to its hydrophobic characteristics, while the furan and alcohol functional groups may impart polar properties, affecting solubility and reactivity. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as flavor and fragrance agents due to their intricate structures and potential for diverse interactions. The specific arrangement of substituents can lead to varied physical and chemical properties, making it a subject of interest in synthetic organic chemistry and materials science.
Formula:C15H26O2
InChI:InChI=1/C15H26O2/c1-11-5-7-12(8-6-11)15(4)10-9-13(17-15)14(2,3)16/h5,12-13,16H,6-10H2,1-4H3
InChI key:InChIKey=RKBAYVATPNYHLW-IPYPFGDCSA-N
SMILES:C[C@@]1(O[C@H](C(C)(C)O)CC1)[C@]2(CCC(C)=CC2)[H]
Synonyms:- (-)-Bisabolol oxide B
- (-)-α-Bisabolol oxide B
- (2S,5S)-Tetrahydro-α,α,5-trimethyl-5-[(1S)-4-methyl-3-cyclohexen-1-yl]-2-furanmethanol
- (2S-(2alpha,5beta(R*)))-Tetrahydro-alpha,alpha,5-trimethyl-5-(4-methyl-3-cyclohexen-1-yl)furan-2-methanol
- 2-Furanmethanol, tetrahydro-α,α,5-trimethyl-5-(4-methyl-3-cyclohexen-1-yl)-, [2S-[2α,5β(R*)]]-
- 2-Furanmethanol, tetrahydro-α,α,5-trimethyl-5-[(1S)-4-methyl-3-cyclohexen-1-yl]-, (2S,5S)-
- 2-[5-Methyl-5-(4-Methylcyclohex-3-En-1-Yl)Tetrahydrofuran-2-Yl]Propan-2-Ol
- Bisabolol oxide II
- (2S)-Tetrahydro-α,α,5-trimethyl-5β-[(S)-4-methyl-3-cyclohexen-1-yl]-2α-furanmethanol
- ALPHA-BISABOLOLOXIDEB
- (2S)-α,α,5-Trimethyl-5β-[(S)-4-methyl-3-cyclohexene-1-yl]tetrahydro-2α-furanmethanol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Bisabolol Oxide B
CAS:Controlled ProductApplications Bisabolol Oxide B is a metabolite of (-)-α-Bisabolol. In the metabolic pathway was used Glomerella Cingulata, a pathogenic fungus. Bisabolol Oxide A and B are in the composition of chamomile flower.
References Hoelzl, J., et al.: J. Biosci., 30, 853 (1975); Gibson, S.E., et al.: Org. Biomol. Chem., 1, 676 (2003);Formula:C15H26O2Color and Shape:NeatMolecular weight:238.37Bisabolol oxide B
CAS:Bisabolol oxide B is a medicinal compound that has been found to have anticancer properties. It has been shown to inhibit the activity of kinases, which are enzymes that play a crucial role in cell signaling and regulation. Bisabolol oxide B has been studied extensively in Chinese medicine and has been found to induce apoptosis (programmed cell death) in cancer cells. This compound is an analog of a naturally occurring protein kinase inhibitor and has been shown to be effective against various types of tumors. In addition, bisabolol oxide B can be detected in human urine and may have potential as a diagnostic marker for certain types of cancer. Overall, this compound holds great promise as a potent anticancer agent with significant therapeutic potential.Formula:C15H26O2Purity:Min. 95%Molecular weight:238.37 g/mol


