CAS 26184-96-3
:6-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranose
Description:
6-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranose, with the CAS number 26184-96-3, is a glycoside that features a glucopyranose unit linked to a 6-deoxy-α-L-mannopyranosyl moiety. This compound is characterized by its structural complexity, which includes multiple hydroxyl groups that contribute to its solubility in water and potential for hydrogen bonding. The presence of the deoxy sugar unit imparts unique properties, influencing its reactivity and biological interactions. Glycosides like this one often exhibit significant roles in biological systems, including serving as intermediates in metabolic pathways or as components of larger biomolecules. The stereochemistry of the glycosidic bond is crucial for its biological activity, as it determines how the molecule interacts with enzymes and receptors. Additionally, this compound may be of interest in the fields of medicinal chemistry and carbohydrate chemistry due to its potential applications in drug development and as a model for studying glycosylation processes. Overall, its unique structural features make it a subject of interest for further research in various scientific domains.
Formula:C12H22O10
InChI:InChI=1S/C12H22O10/c1-3-5(13)7(15)10(18)12(21-3)20-2-4-6(14)8(16)9(17)11(19)22-4/h3-19H,2H2,1H3/t3-,4+,5-,6+,7+,8-,9+,10+,11+,12+/m0/s1
InChI key:InChIKey=OVVGHDNPYGTYIT-BNXXONSGSA-N
SMILES:C(O[C@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O1)[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)O2
Synonyms:- (2R,3R,4R,5S,6S)-6-{[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl]methoxy}tetrahydro-2H-pyran-2,3,4,5-tetrol (non-preferred name)
- 6-O-(6-Deoxy-alpha-L-mannopyranosyl)-beta-D-glucose
- 6-O-(6-Deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-β-<smallcap>D</span>-glucopyranose
- 6-O-(6-deoxy-alpha-L-mannopyranosyl)-D-glucose
- Rutinose, β-
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranose, 6-O-(6-deoxy-α-<smallcap>L</span>-mannopyranosyl)-
- β-Rutinose
- 6-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranose
- β-D-Glucopyranose, 6-O-(6-deoxy-α-L-mannopyranosyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
β-Rutinose
CAS:Beta-rutinose is a potent kinase inhibitor that has shown anti-tumor activity in Chinese hamster ovary (CHO) cells. It inhibits the activity of cyclin-dependent kinases, which are essential for cell division and proliferation. Beta-rutinose has been shown to induce apoptosis in human cancer cells, making it a promising candidate for anticancer therapy. This compound is an analog of rutin, a flavonoid found in many plants, and has been shown to have potent anticancer effects in vitro and in vivo. Beta-rutinose inhibits the growth of cancer cells by blocking the activity of specific kinases involved in tumor progression, making it an attractive target for developing new cancer therapies. Additionally, this compound has been found to be effective at reducing protein levels associated with cancer cell growth and proliferation.Formula:C12H22O10Purity:Min. 95%Molecular weight:326.3 g/mol
