CAS 2619-88-7

Palmiticacidhydrazide

Description:

Palmitic acid hydrazide, with the CAS number 2619-88-7, is an organic compound derived from palmitic acid, a saturated fatty acid. It is characterized by the presence of a hydrazide functional group, which is formed by the reaction of hydrazine with the carboxylic acid group of palmitic acid. This compound typically appears as a white to off-white solid and is soluble in organic solvents. Palmitic acid hydrazide is known for its applications in various fields, including biochemistry and materials science, often serving as a building block in the synthesis of more complex molecules. Its hydrazide functionality can participate in various chemical reactions, such as condensation and coupling reactions, making it useful in the development of pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, although specific properties can vary based on the context of its use. As with many hydrazides, it is important to handle this compound with care due to potential reactivity and safety considerations.

Formula: C₁₆H₃₄N₂O

InChI: InChI=1/C16H34N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(19)18-17/h2-15,17H2,1H3,(H,18,19)

SMILES: CCCCCCCCCCCCCCCC(=NN)O

Synonyms:

• Hexadecanehydrazide
• Hexadecanoic Acid, Hydrazide

Palmitic Acid Hydrazide

CAS: 2619-88-7

Formula: C₁₆H₃₄N₂O

Purity: >98.0%(T)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 270.46

Ref: 3B-P0004

Hexadecanoic acid, hydrazide

CAS: 2619-88-7

Formula: C₁₆H₃₄N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 270.4540

Ref: IN-DA002S5C

Palmitohydrazide

CAS: 2619-88-7

Palmitohydrazide

Purity: 98%（ELSD)

Molecular weight: 270.45g/mol

Ref: 54-OR1028293

Palmitic acid hydrazide

CAS: 2619-88-7

Formula: C₁₆H₃₄N₂O

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 270.461

Ref: 10-F163100