CAS 261944-16-5

3-(Difluoromethylthio)benzoyl chloride

Description:

3-(Difluoromethylthio)benzoyl chloride is an organic compound characterized by the presence of a benzoyl chloride functional group attached to a difluoromethylthio substituent. This compound features a benzene ring, which is a stable aromatic structure, and a carbonyl group (C=O) that is part of the benzoyl moiety, contributing to its reactivity. The difluoromethylthio group introduces both sulfur and fluorine atoms, enhancing the compound's electrophilic properties and making it useful in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The presence of the chlorine atom in the benzoyl chloride structure makes it a good acylating agent, allowing it to participate in nucleophilic acyl substitution reactions. Additionally, the difluoromethylthio group can influence the compound's lipophilicity and biological activity. Overall, 3-(Difluoromethylthio)benzoyl chloride is a valuable intermediate in organic synthesis, with applications in medicinal chemistry and materials science.

Formula: C₈H₅ClF₂OS

InChI: InChI=1/C8H5ClF2OS/c9-7(12)5-2-1-3-6(4-5)13-8(10)11/h1-4,8H

SMILES: c1cc(cc(c1)SC(F)F)C(=O)Cl

Synonyms:

• 3-[(Difluoromethyl)Sulfanyl]Benzoyl Chloride

Benzoyl chloride, 3-[(difluoromethyl)thio]-

CAS: 261944-16-5

Formula: C₈H₅ClF₂OS

Molecular weight: 222.6395

Ref: IN-DA002S5V

3-(Difluoromethylthio)benzoyl chloride

CAS: 261944-16-5

3-(Difluoromethylthio)benzoyl chloride

Purity: ≥95%

Molecular weight: 222.64g/mol

Ref: 54-PC0276