CAS 261944-18-7

2-[(Difluoromethyl)thio]benzenemethanol

Description:

2-[(Difluoromethyl)thio]benzenemethanol, with the CAS number 261944-18-7, is an organic compound characterized by the presence of a difluoromethylthio group attached to a benzenemethanol structure. This compound features a benzene ring substituted with a thiol group that contains a difluoromethyl moiety, which contributes to its unique chemical properties. The difluoromethyl group is known for its electron-withdrawing effects, which can influence the reactivity and stability of the compound. The hydroxyl (-OH) group in the benzenemethanol portion provides the compound with potential hydrogen bonding capabilities, affecting its solubility and interaction with other molecules. Typically, compounds like this may exhibit moderate to high polarity due to the presence of both the hydroxyl and difluoromethyl groups. Additionally, the presence of fluorine atoms can enhance the compound's lipophilicity and alter its biological activity. Overall, 2-[(Difluoromethyl)thio]benzenemethanol is of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features.

Formula: C₈H₈F₂OS

InChI: InChI=1S/C8H8F2OS/c9-8(10)12-7-4-2-1-3-6(7)5-11/h1-4,8,11H,5H2

InChI key: InChIKey=JUVQZOQEFRPHIL-UHFFFAOYSA-N

SMILES: S(C(F)F)C1=C(CO)C=CC=C1

Synonyms:

• Benzenemethanol, 2-[(difluoromethyl)thio]-
• 2-[(Difluoromethyl)thio]benzenemethanol
• (2-((difluoroMethyl)thio)phenyl)Methanol

{2-[(difluoromethyl)sulfanyl]phenyl}methanol

CAS: 261944-18-7

Formula: C₈H₈F₂OS

Molecular weight: 190.2103

Ref: IN-DA002S5U

2-(Difluoromethylthio)benzyl alcohol

CAS: 261944-18-7

2-(Difluoromethylthio)benzyl alcohol

Purity: ≥95%

Molecular weight: 190.21g/mol

Ref: 54-PC0279

{2-[(Difluoromethyl)sulfanyl]phenyl}methanol

CAS: 261944-18-7

Versatile small molecule scaffold

Formula: C₈H₈F₂OS

Purity: Min. 95%

Molecular weight: 190.21 g/mol

Ref: 3D-LKA94418