CAS 261944-97-2
:4,5-difluoro-2-(trifluoromethyl)benzamide
Description:
4,5-Difluoro-2-(trifluoromethyl)benzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms at the 4 and 5 positions and a trifluoromethyl group at the 2 position. This compound features a carbonyl group (amide functional group) attached to the benzene ring, contributing to its chemical reactivity and potential applications in pharmaceuticals and agrochemicals. The presence of multiple fluorine atoms enhances its lipophilicity and stability, making it resistant to metabolic degradation. Additionally, the fluorinated groups can influence the compound's electronic properties, potentially affecting its interactions with biological targets. The compound is typically synthesized through specific fluorination reactions and can be analyzed using techniques such as NMR and mass spectrometry. Its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. As with many fluorinated compounds, considerations regarding environmental impact and toxicity are essential in its application and handling.
Formula:C8H4F5NO
InChI:InChI=1S/C8H4F5NO/c9-5-1-3(7(14)15)4(2-6(5)10)8(11,12)13/h1-2H,(H2,14,15)
InChI key:InChIKey=NTEWBCFPFIDECK-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(C(F)(F)F)C=C(F)C(F)=C1
Synonyms:- Benzamide, 4,5-Difluoro-2-(Trifluoromethyl)-
- 4,5-Difluoro-2-(trifluoromethyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4,5-Difluoro-2-(trifluoromethyl)benzamide
CAS:4,5-Difluoro-2-(trifluoromethyl)benzamide
Molecular weight:225.12g/mol

