CAS 261951-78-4
:4-Fluoro-3-methoxybenzotrifluoride
Description:
4-Fluoro-3-methoxybenzotrifluoride, with the CAS number 261951-78-4, is an aromatic compound characterized by the presence of a fluorine atom, a methoxy group, and three trifluoromethyl groups attached to a benzene ring. This compound exhibits a high degree of fluorination, which typically enhances its chemical stability and lipophilicity, making it useful in various applications, including pharmaceuticals and agrochemicals. The methoxy group contributes to its electronic properties, potentially influencing reactivity and solubility. As a fluorinated aromatic compound, it may also exhibit unique physical properties such as increased boiling and melting points compared to non-fluorinated analogs. Additionally, the presence of multiple electronegative fluorine atoms can affect the compound's polarity and intermolecular interactions. Safety data sheets should be consulted for handling and toxicity information, as fluorinated compounds can pose environmental and health risks. Overall, 4-Fluoro-3-methoxybenzotrifluoride is a significant compound in the field of synthetic chemistry and material science.
Formula:C8H6F4O
InChI:InChI=1/C8H6F4O/c1-13-7-4-5(8(10,11)12)2-3-6(7)9/h2-4H,1H3
SMILES:COc1cc(ccc1F)C(F)(F)F
Synonyms:- 2-Fluoro-5-(trifluoromethoxy)anisole
- 2-Fluoro-5-(trifluoromethyl)anisole
- 1-Fluoro-2-Methoxy-4-(Trifluoromethyl)Benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Fluoro-5-(trifluoromethyl)anisole, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H6F4OPurity:97%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:194.13Benzene, 1-fluoro-2-methoxy-4-(trifluoromethyl)-
CAS:Formula:C8H6F4OPurity:95%Color and Shape:LiquidMolecular weight:194.12632-Fluoro-5-(trifluoromethyl)anisole
CAS:2-Fluoro-5-(trifluoromethyl)anisoleFormula:C8H6F4OPurity:98%Color and Shape:LiquidMolecular weight:194.13g/mol2-Fluoro-5-(trifluoromethyl)anisole
CAS:Formula:C8H6F4OPurity:≥95%Color and Shape:LiquidMolecular weight:194.129



