CymitQuimica logo

CAS 261952-15-2

:

4-METHYL-3-(TRIFLUOROMETHYL)BENZYL ALCOHOL

Description:
4-Methyl-3-(trifluoromethyl)benzyl alcohol is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a methyl group and a trifluoromethyl group, along with a hydroxymethyl group. This compound typically exhibits properties associated with both alcohols and aromatic compounds, such as moderate solubility in polar solvents and potential reactivity in various chemical reactions, including oxidation and substitution. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and material science. Additionally, the compound may exhibit unique physical properties, such as specific melting and boiling points, which are influenced by the steric and electronic effects of its substituents. Its CAS number, 261952-15-2, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H9F3O
InChI:InChI=1S/C9H9F3O/c1-6-2-3-7(5-13)4-8(6)9(10,11)12/h2-4,13H,5H2,1H3
InChI key:IUUCVMGJQLDSFO-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1)CO)C(F)(F)F
Found 4 products.