CAS 261952-23-2

α-Amino-3-(trifluoromethoxy)benzeneacetic acid

Description:

α-Amino-3-(trifluoromethoxy)benzeneacetic acid, with the CAS number 261952-23-2, is an organic compound characterized by the presence of an amino group and a trifluoromethoxy substituent on a benzene ring. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The trifluoromethoxy group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The presence of the amino group allows for potential interactions in biological systems, such as hydrogen bonding and ionic interactions. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid and amino functionalities, while the trifluoromethoxy group may impart unique electronic properties. Overall, α-Amino-3-(trifluoromethoxy)benzeneacetic acid is a compound of interest in medicinal chemistry, particularly for its potential applications in drug development and synthesis.

Formula: C₉H₈F₃NO₃

InChI: InChI=1S/C9H8F3NO3/c10-9(11,12)16-6-3-1-2-5(4-6)7(13)8(14)15/h1-4,7H,13H2,(H,14,15)

InChI key: InChIKey=JSRHISPHWIGFLQ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N)C1=CC(OC(F)(F)F)=CC=C1

Synonyms:

• 2-Amino-2-[3-(trifluoromethoxy)phenyl]acetic acid
• Benzeneacetic acid, α-amino-3-(trifluoromethoxy)-
• α-Amino-3-(trifluoromethoxy)benzeneacetic acid

2-amino-2-[3-(trifluoromethoxy)phenyl]acetic acid

CAS: 261952-23-2

Formula: C₉H₈F₃NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 235.1599

Ref: IN-DA002S6Z

3-(Trifluoromethoxy)-DL-phenylglycine

CAS: 261952-23-2

3-(Trifluoromethoxy)-DL-phenylglycine

Formula: C₉H₈F₃NO₃

Purity: ≥95%

Color and Shape: white solid

Molecular weight: 235.16g/mol

Ref: 54-PC0517