CymitQuimica logo

CAS 261952-28-7

:

3-Ethylidene-6-propylidene-2,5-piperazinedione

Description:
3-Ethylidene-6-propylidene-2,5-piperazinedione, identified by its CAS number 261952-28-7, is a synthetic organic compound that belongs to the class of piperazinediones. This compound features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. The presence of ethylidene and propylidene substituents contributes to its unique chemical properties, potentially influencing its reactivity and interactions with biological systems. The compound may exhibit characteristics typical of piperazinediones, such as the ability to form hydrogen bonds due to the carbonyl groups present in the structure. These features can affect its solubility, stability, and potential applications in pharmaceuticals or agrochemicals. Additionally, the specific arrangement of substituents can impact its biological activity, making it of interest for research in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its properties, including its synthesis, reactivity, and potential uses in various fields.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-3-5-7-9(13)10-6(4-2)8(12)11-7/h4-5H,3H2,1-2H3,(H,10,13)(H,11,12)
InChI key:InChIKey=IDKCJUWXNUFKNA-UHFFFAOYSA-N
SMILES:C(CC)=C1C(=O)NC(=CC)C(=O)N1
Synonyms:
  • 3-Ethylidene-6-propylidene-2,5-piperazinedione
  • 2,5-Piperazinedione, 3-ethylidene-6-propylidene-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.