CAS 26197-93-3
:4-bromobenzenecarbothioamide
Description:
4-Bromobenzenecarbothioamide, with the CAS number 26197-93-3, is an organic compound characterized by the presence of a bromine atom and a thioamide functional group attached to a benzene ring. This compound features a bromobenzene moiety, where the bromine substituent is located at the para position relative to the carbothioamide group. The thioamide functional group, which consists of a carbonyl (C=O) bonded to a sulfur atom (S), imparts unique reactivity and properties to the molecule, making it useful in various chemical applications. 4-Bromobenzenecarbothioamide is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical structure allows for potential interactions in nucleophilic substitution reactions, and it may serve as a precursor in the synthesis of other organic compounds. Additionally, the presence of the bromine atom can enhance the compound's reactivity and influence its biological activity, making it of interest in medicinal chemistry and material science.
Formula:C7H6BrNS
InChI:InChI=1/C7H6BrNS/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)
SMILES:c1cc(ccc1C(=S)N)Br
Synonyms:- Benzenecarbothioamide, 4-bromo-
- Suyzr De
- 4-Bromobenzenecarbothioamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromothiobenzamide, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H6BrNSPurity:97%Molecular weight:216.1Benzenecarbothioamide, 4-bromo-
CAS:Formula:C7H6BrNSPurity:98%Color and Shape:SolidMolecular weight:216.0982
