CAS 26198-19-6

6-Chloro-1-Hydroxybenzotriazole

Description:

6-Chloro-1-Hydroxybenzotriazole (CAS 26198-19-6) is an organic compound characterized by its benzotriazole structure, which features a hydroxyl group and a chlorine substituent. This compound is typically a white to off-white solid and is known for its role as a UV absorber and stabilizer in various applications, particularly in plastics, coatings, and polymers. Its chemical structure allows it to effectively absorb ultraviolet light, thereby protecting materials from photodegradation. Additionally, 6-Chloro-1-Hydroxybenzotriazole exhibits good thermal stability and solubility in organic solvents, making it suitable for incorporation into various formulations. The presence of the chlorine atom enhances its reactivity and stability compared to other benzotriazole derivatives. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, its unique properties make it valuable in industrial applications where UV protection is essential.

Formula: C₆H₄ClN₃O

InChI: InChI=1/C6H4ClN3O/c7-4-1-2-5-6(3-4)10(11)9-8-5/h1-3,11H

SMILES: c1cc2c(cc1Cl)n(nn2)O

Synonyms:

• 6-Cl-HOBT
• 6-Chloro-1-Hydroxy-1H-Benzotriazole
• Cl-HOBT
• 6-Chloro-1-hydroxibenzotriazol
• 6-chloro-1H-benzotriazol-1-ol

6-Chloro-1-hydroxybenzotriazole with 10% of water

CAS: 26198-19-6

Formula: C₆H₄ClN₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 169.5685

Ref: IN-DA002S8E

6-Chloro-1-hydroxybenzotriazole hydrate

CAS: 26198-19-6

Formula: C₆H₄ClN₃O·xH₂O

Purity: (HPLC) ≥ 98.0%

Color and Shape: White or almost white crystalline powder

Molecular weight: 169.57 (anhydrous)

Ref: 7W-GE4630

6-Chloro-1H-benzo[d][1,2,3]triazol-1-ol

CAS: 26198-19-6

Purity: 98%

Molecular weight: 169.57

Ref: 10-F791483