CymitQuimica logo

CAS 262-76-0

:

Corrin

Description:
Corrin is a complex organic molecule that serves as a key structural component in certain cobalt-containing compounds, particularly in the context of vitamin B12 and related compounds. It is characterized by a corrin ring, which is a cyclic structure composed of four pyrrole-like subunits linked by methine bridges. This unique arrangement allows for the coordination of a central metal ion, typically cobalt, which is crucial for the biological activity of vitamin B12. Corrin exhibits a planar structure and is relatively stable, but its reactivity can vary depending on the metal ion it coordinates with. The presence of various functional groups attached to the corrin ring can influence its solubility, stability, and biological interactions. Corrin derivatives play significant roles in biological systems, particularly in enzymatic reactions and as cofactors in metabolic pathways. The CAS number 262-76-0 specifically identifies a particular corrin compound, which may have distinct properties and applications in biochemistry and medicinal chemistry.
Formula:C19H22N4
InChI:InChI=1S/C19H22N4/c1-3-14-10-16-5-7-18(22-16)19-8-6-17(23-19)11-15-4-2-13(21-15)9-12(1)20-14/h9-11,18-19,22H,1-8H2
InChI key:InChIKey=WUPRCGRRQUZFAB-UHFFFAOYSA-N
SMILES:C12C3N=C(CC3)C=C4N=C(CC4)C=C5N=C(C=C(N1)CC2)CC5
Synonyms:
  • Corphyrin
  • Corrin
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.