
CAS 26214-65-3
:3-furoyl chloride
Description:
3-Furoyl chloride, with the CAS number 26214-65-3, is an acyl chloride derived from furan. It features a furan ring substituted with a carbonyl chloride group at the 3-position. This compound is characterized by its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a potent electrophile. It is typically a colorless to pale yellow liquid with a pungent odor, and it is known for its ability to react with water, alcohols, and amines, leading to the formation of corresponding carboxylic acids, esters, and amides, respectively. 3-Furoyl chloride is utilized in organic synthesis, particularly in the preparation of various furoyl derivatives and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Due to its reactive nature, it should be handled with care, as it can cause irritation to the skin, eyes, and respiratory system. Proper safety precautions, including the use of personal protective equipment, are essential when working with this compound.
Formula:C5H3ClO2
InChI:InChI=1/C5H3ClO2/c6-5(7)4-1-2-8-3-4/h1-3H
SMILES:c1cocc1C(=O)Cl
Synonyms:- Furan-3-Carbonyl Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Furancarbonyl chloride
CAS:Formula:C5H3ClO2Purity:97%Color and Shape:LiquidMolecular weight:130.52913-Furoyl chloride
CAS:<p>3-Furoyl chloride</p>Formula:C5H3ClO2Purity:≥95%Color and Shape: white low melting solidMolecular weight:130.53g/mol3-Furoyl chloride
CAS:<p>3-Furoyl chloride is a chemical substance that is used as a reagent and building block in organic synthesis.</p>Formula:C5H3ClO2Purity:Min. 96.5 Area-%Molecular weight:130.53 g/molFuran-3-carbonyl chloride
CAS:Formula:C5H3ClO2Purity:97%Color and Shape:Solid, Low Melting SolidMolecular weight:130.533-Furoyl Chloride pure, 97%
CAS:Formula:C5H3ClO2Purity:min. 97%Color and Shape:Clear, Yellow to pale brown, Liquid or solidMolecular weight:130.53




