CAS 26215-17-8

4-Amino-2-(2-hydroxyethyl)-1H-isoindole-1,3(2H)-dione

Description:

4-Amino-2-(2-hydroxyethyl)-1H-isoindole-1,3(2H)-dione, also known by its CAS number 26215-17-8, is an organic compound characterized by its isoindole structure, which features a fused benzene and pyrrole ring. This compound contains an amino group and a hydroxyethyl substituent, contributing to its potential reactivity and solubility in polar solvents. The presence of the dione functional groups indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Its molecular structure suggests that it may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The compound is typically a solid at room temperature and may have specific melting and boiling points that depend on its purity and crystalline form. Additionally, it may be sensitive to light and moisture, necessitating careful handling and storage conditions. Overall, 4-Amino-2-(2-hydroxyethyl)-1H-isoindole-1,3(2H)-dione is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₀H₁₀N₂O₃

InChI: InChI=1S/C10H10N2O3/c11-7-3-1-2-6-8(7)10(15)12(4-5-13)9(6)14/h1-3,13H,4-5,11H2

InChI key: InChIKey=ZFJCEBBQMMSHIT-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)N1CCO)=CC=CC2N

Synonyms:

• 3-Amino-N-(2-hydroxyethyl)phthalimide
• 1H-Isoindole-1,3(2H)-dione, 4-amino-2-(2-hydroxyethyl)-
• 4-Amino-2-(2-hydroxyethyl)-1H-isoindole-1,3(2H)-dione
• Phthalimide, 3-amino-N-(2-hydroxyethyl)-
• 3-Aminophthalic β-hydroxyethylimide