CAS 26218-78-0
:6-Bromonicotinic acid methyl ester
Description:
6-Bromonicotinic acid methyl ester is a chemical compound characterized by its structure, which includes a bromine atom and a methyl ester functional group attached to a nicotinic acid backbone. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as methanol and dimethyl sulfoxide, but may have limited solubility in water. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the bromine atom can enhance the compound's reactivity and influence its biological activity. Additionally, 6-bromonicotinic acid methyl ester may serve as an intermediate in the synthesis of more complex molecules. Safety data indicates that, like many brominated compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper laboratory safety protocols should be followed when working with this substance.
Formula:C7H6BrNO2
InChI:InChI=1/C7H6BrNO2/c1-11-7(10)5-2-3-6(8)9-4-5/h2-4H,1H3
SMILES:COC(=O)c1ccc(Br)nc1
Synonyms:- Methyl 6-bromonicotinate
- Methyl 6-Bromopyridine-3-Carboxylate
- Methyl 6-Bromo-Nicotinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 6-Bromonicotinate
CAS:Formula:C7H6BrNO2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:216.03Methyl 6-bromonicotinate
CAS:Formula:C7H6BrNO2Purity:97%Color and Shape:Solid or Semi-solid or liquid or lumpMolecular weight:216.033-Pyridinecarboxylic acid, 6-bromo-, methyl ester
CAS:Formula:C7H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:216.0320Methyl 6-bromonicotinate
CAS:<p>Methyl 6-bromonicotinate</p>Formula:C7H6BrNO2Purity:97%Color and Shape: off-white solidMolecular weight:216.03g/molMethyl 6-bromonicotinate
CAS:Formula:C7H6NO2BrPurity:≥ 98.0%Color and Shape:White solidMolecular weight:216.03Methyl 6-bromo-nicotinate
CAS:Formula:C7H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:216.034





