CAS 2622-07-3
:N,N,N′,N′,N′′,N′′-Hexaethylphosphoric triamide
Description:
N,N,N′,N′,N′′,N′′-Hexaethylphosphoric triamide (CAS 2622-07-3) is an organophosphorus compound characterized by its structure, which includes a phosphorus atom bonded to three ethylamide groups. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its ability to act as a solvent and extractant, particularly in the separation of metal ions and in various chemical processes. Hexaethylphosphoric triamide exhibits good thermal stability and is soluble in organic solvents, making it useful in industrial applications. Additionally, it has a relatively low toxicity compared to other organophosphorus compounds, although proper handling and safety precautions are still necessary due to potential health risks. Its unique properties make it valuable in fields such as analytical chemistry, nuclear chemistry, and materials science, where it can facilitate the extraction and purification of specific ions or compounds.
Formula:C12H30N3OP
InChI:InChI=1S/C12H30N3OP/c1-7-13(8-2)17(16,14(9-3)10-4)15(11-5)12-6/h7-12H2,1-6H3
InChI key:InChIKey=ROZPNEGZBIUWBX-UHFFFAOYSA-N
SMILES:P(N(CC)CC)(N(CC)CC)(N(CC)CC)=O
Synonyms:- N,N,N′,N′,N′′,N′′-Hexaethylphosphoric triamide
- Phosphoric triamide, N,N,N′,N′,N′′,N′′-hexaethyl-
- Hexaethylphosphoric triamide
- Hexaethylphosphoramide
- Phosphoric triamide, hexaethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
