CAS 2622-67-5

1,2-Diphenylbenzimidazole

Description:

1,2-Diphenylbenzimidazole, with the CAS number 2622-67-5, is an organic compound characterized by its structure, which features a benzimidazole core substituted with two phenyl groups at the 1 and 2 positions. This compound typically appears as a crystalline solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as moderate solubility in organic solvents and stability under standard conditions. The presence of the benzimidazole moiety contributes to its biological activity, making it of interest in medicinal chemistry. Additionally, 1,2-Diphenylbenzimidazole may exhibit UV-absorbing properties, which can be advantageous in formulations requiring UV protection. Its synthesis often involves the condensation of appropriate aniline derivatives with o-phenylenediamine. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Overall, 1,2-Diphenylbenzimidazole is a versatile compound with significant relevance in both research and industrial applications.

Formula: C₁₉H₁₄N₂

InChI: InChI=1/C19H14N2/c1-3-9-15(10-4-1)19-20-17-13-7-8-14-18(17)21(19)16-11-5-2-6-12-16/h1-14H

SMILES: c1ccc(cc1)c1nc2ccccc2n1c1ccccc1

Synonyms:

• 1,2-Diphenyl-1H-Benzimidazole

1H-Benzimidazole, 1,2-diphenyl-

CAS: 2622-67-5

Formula: C₁₉H₁₄N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 270.3279

Ref: IN-DA002SC8

1,2-Diphenyl-1H-benzo[d]imidazole

CAS: 2622-67-5

1,2-Diphenyl-1H-benzo[d]imidazole

Purity: 95%

Molecular weight: 270.33g/mol

Ref: 54-OR1070439

1,2-Diphenyl-1H-benzo[d]imidazole

CAS: 2622-67-5

Purity: 95%

Molecular weight: 270.3349914550781

Ref: 10-F689995

1,2-Diphenyl-1H-benzimidazole

CAS: 2622-67-5

1,2-Diphenyl-1H-benzimidazole is a heterocyclic organic compound that has two phenyl groups and two hydrogen atoms. It is an electron acceptor and has a redox potential of -0.8 V. It also has the ability to undergo photophysical reactions. The molecule's chemical reactions depend on the presence of ancillary functional groups, which are electron donating or withdrawing groups. 1,2-Diphenyl-1H-benzimidazole can be used as a reagent in organic synthesis due to its functional groups.

Formula: C₁₉H₁₄N₂

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 270.33 g/mol

Ref: 3D-FD147691