CymitQuimica logo

CAS 2622-74-4

:

2-(4-bromophenyl)-1H-benzimidazole

Description:
2-(4-bromophenyl)-1H-benzimidazole is an organic compound characterized by its structure, which features a benzimidazole core substituted with a 4-bromophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential biological activity. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and solubility. It is often used in medicinal chemistry and research due to its potential pharmacological properties, including antimicrobial and anticancer activities. The compound is generally soluble in organic solvents and may have limited solubility in water, which is common for many benzimidazole derivatives. Its molecular structure allows for various interactions, making it a candidate for further studies in drug development and material science. Safety data should be consulted for handling and usage, as halogenated compounds can pose specific health risks. Overall, 2-(4-bromophenyl)-1H-benzimidazole is a significant compound in the field of organic chemistry and medicinal research.
Formula:C13H9BrN2
InChI:InChI=1/C13H9BrN2/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13/h1-8H,(H,15,16)
InChI key:YRWMGOSKROWAIT-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)[nH]c(c1ccc(cc1)Br)n2
Synonyms:
  • 1H-benzimidazole, 2-(4-bromophenyl)-
  • 2-(4-Bromophenyl)Benzimidazole
Found 4 products.