CymitQuimica logo

CAS 262296-01-5

:

2-(2,2,2-Trifluoroethoxy)- 4-pyridinecarboxylic acid

Description:
2-(2,2,2-Trifluoroethoxy)-4-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a carboxylic acid group and an ethoxy group containing trifluoromethyl groups. This compound is typically a white to off-white solid at room temperature and is soluble in polar organic solvents. The presence of the trifluoroethoxy group imparts significant polarity and can influence the compound's reactivity and interaction with biological systems. It may exhibit properties such as being a potential herbicide or pharmaceutical intermediate due to its ability to interact with various biological targets. The carboxylic acid functionality allows for potential hydrogen bonding, enhancing solubility and reactivity. Additionally, the trifluoromethyl group can enhance lipophilicity and metabolic stability. As with many fluorinated compounds, it may exhibit unique environmental persistence and bioactivity, necessitating careful handling and assessment of its ecological impact. Overall, this compound's distinct characteristics make it of interest in both synthetic chemistry and potential applications in agrochemicals or pharmaceuticals.
Formula:C8H6F3NO3
InChI:InChI=1/C8H6F3NO3/c9-8(10,11)4-15-6-3-5(7(13)14)1-2-12-6/h1-3H,4H2,(H,13,14)
SMILES:c1cnc(cc1C(=O)O)OCC(F)(F)F
Synonyms:
  • 2-(2,2,2-Trifluoroethoxy)Pyridine-4-Carboxylic Acid
  • 2-(2,2,2-Trifluoroethoxy)-4-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.